Name |
alpha-Phellandrene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
99-83-2 |
C_ID |
C00003051
, 
|
InChIKey |
OGLDWXZKYODSOB-UEQNJFAPNA-N |
InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4-6,8,10H,7H2,1-3H3/t10-/m1/s1 |
SMILES |
C1=C[C@H](CC=C1C)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Feces) | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Anacardiaceae | Pistacia lentiscus  | Ref. |
Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
Plantae | Annonaceae | Monodora myristica  | Ref. |
Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
Plantae | Apiaceae | Cuminum cyminum L.  | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Ligusticum jeholense | Ref. |
Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Petasites albus  | Ref. |
Plantae | Asteraceae | Petasites hybridus  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Asteraceae | Saussurea lappa  | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cupressaceae | Juniperus spp. | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
Plantae | Fagaceae | Quercus coccifera  | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
Plantae | Labiatae | Mentha spp.  | Ref. |
Plantae | Labiatae | Ocimum gratissimum  | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Thymus X-porlock | Ref. |
Plantae | Labiatae | Thymus eriocalyx | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Lauraceae | Cinnamomum augustifolium | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Myrtaceae | Eucalyptus elata | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
Plantae | Myrtaceae | Eucalyptus microtheca  | Ref. |
Plantae | Myrtaceae | Eucalyptus phellandra | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Pinaceae | Pinus cembra  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
Plantae | Pinaceae | Pinus radiata | Ref. |
Plantae | Pinaceae | Pinus spp.  | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus medica  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
Plantae | Saururaceae | Houttuynia cordata Thunb.  | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Verbenaceae | Lippia chevalieri | Ref. |
Plantae | Verbenaceae | Lippia multiflora  | Ref. |
Plantae | Zingiberaceae | Alpinia allughas  | Ref. |
Plantae | Zingiberaceae | Amomum medium | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L.  | Ref. |
- | - | Trachyspermum roxburghianum  | Ref. |
|
|
zoom in
Organism | Notopterygium forbesii | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
---|
|