Name |
Desmethoxysudachitin 5,7,4'-Trihydroxy-6,8-dimethoxyflavone 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethoxy-4H-1-benzopyran-4-one |
Formula |
C17H14O7 |
Mw |
330.0739528 |
CAS RN |
4323-80-2 |
C_ID |
C00003876
,
|
InChIKey |
SYGUVOLSUJYPPS-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O7/c1-22-16-13(20)12-10(19)7-11(8-3-5-9(18)6-4-8)24-15(12)17(23-2)14(16)21/h3-7,18,20-21H,1-2H3 |
SMILES |
c1(c(c(c2c(c1OC)oc(cc2=O)c1ccc(cc1)O)O)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ambrosia deltoidea | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
Plantae | Asteraceae | Madia capitata | Ref. |
Plantae | Asteraceae | Wilkesia hobdyi | Ref. |
Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
Plantae | Fabaceae | Ononis natrix | Ref. |
Plantae | Labiatae | Mentha piperita | Ref. |
Plantae | Labiatae | Scutellaria repens | Ref. |
Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
Plantae | Rubiaceae | Gardenia lucida | Ref. |
Plantae | Rutaceae | Citrus sudachi | Ref. |
|
|
zoom in
Organism | Gardenia lucida | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Horie, J.Chem.Soc.Jpn,83,(1962),602
Wollenweber,J.Plant Physiol.,131,(1987),37 |
---|
|