| Name |
Kumatakenin
Kumatakillin
5,4'-Dihydroxy-3,7-dimethoxyflavone
Jaranol
Kaempferol 3,7-O-dimethyl ether
5-Hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
3301-49-3 |
| C_ID |
C00004569
, 
|
| InChIKey |
BJBUTJQYZDYRMJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-11-7-12(19)14-13(8-11)23-16(17(22-2)15(14)20)9-3-5-10(18)6-4-9/h3-8,18-19H,1-2H3 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(cc1)O)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea ageratum  | Ref. |
| Plantae | Asteraceae | Flourensia retinophylla | Ref. |
| Plantae | Boraginaceae | Alkanna orientalis | Ref. |
| Plantae | Boraginaceae | Heliotropium chenopodiaceum var. ericoideum | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Calceolariaceae | Calceolaria arachnoidea | Ref. |
| Plantae | Capparaceae | Cleome spinosa | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
| Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
| Plantae | Fabaceae | Astragalus membranaceus | Ref. |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glara | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
| Plantae | Geraniaceae | Geranium macrorrhizum L. | Ref. |
| Plantae | Geraniaceae | Pelargonium fulgidum | Ref. |
| Plantae | Labiatae | Salvia cyanescens | Ref. |
| Plantae | Labiatae | Salvia glutinosa | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus cunninghamii | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis L. | Ref. |
| Plantae | Rutaceae | Bosistoa brassii | Ref. |
| Plantae | Rutaceae | Evodia merrillii | Ref. |
| Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
| Plantae | Santalaceae | Viscum album | Ref. |
| Plantae | Santalaceae | Viscum cruciatum | Ref. |
| Plantae | Solanaceae | Chamaesaracha sordida | Ref. |
| Plantae | Solanaceae | Solanum paludosum | Ref. |
| Plantae | Zingiberaceae | Alpinia japonica | Ref. |
| Plantae | Zingiberaceae | Alpinia kumatake | Ref. |
| Plantae | Zingiberaceae | Amomum koenigii | Ref. |
| - | - | Microtonea prainiana | Ref. |
|
|
zoom in
| Organism | Astragalus membranaceus |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Xing, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 593.
Li, et al., Journal of Natural Products, 67, (2004), 978 |
|---|
|
