Name |
3-O-Methylquercetin 7-O-beta-D-glucopyranoside Quercetin 3-methyl ether 7-glucoside |
Formula |
C22H22O12 |
Mw |
478.11112617 |
CAS RN |
26931-68-0 |
C_ID |
C00005491
,
|
InChIKey |
LKXBGSZMRNJAST-BAZAILPONA-N |
InChICode |
InChI=1S/C22H22O12/c1-31-21-17(28)15-12(26)5-9(32-22-19(30)18(29)16(27)14(7-23)34-22)6-13(15)33-20(21)8-2-3-10(24)11(25)4-8/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16-,18+,19-,22-/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achyrocline alata | Ref. |
Plantae | Asteraceae | Artemisia serotina | Ref. |
Plantae | Asteraceae | Artemisia transiliensis | Ref. |
Plantae | Asteraceae | Asanthus solidaginifolia | Ref. |
Plantae | Asteraceae | Inula viscosa | Ref. |
Plantae | Asteraceae | Viguiera spp. | Ref. |
Plantae | Cactaceae | Opuntia dillenii HAW. | Ref. |
Plantae | Cactaceae | Parodia sanguiniflora | Ref. |
Plantae | Melianthaceae | Francoa sonchifolia | Ref. |
Plantae | Onagraceae | Oenothera purpusii | Ref. |
Plantae | Onagraceae | Oenothera rosea | Ref. |
Plantae | Onagraceae | Oenothera texensis | Ref. |
Plantae | Plumbaginaceae | Limonium gmelinii | Ref. |
Plantae | Solanaceae | Solanum spp. | Ref. |
|
|
zoom in
Organism | Oenothera rosea | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Chumbalov,Khim.Prir,Soedin.,5,(1969),439
Lksuz,Planta Med.,31,(1977),270 |
---|
|