Name |
Sabinene 4(10)-Thujene Sabinen |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
3387-41-5 |
C_ID |
C00031258
, 
|
InChIKey |
NDVASEGYNIMXJL-UHFFFAOYNA-N |
InChICode |
InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3/t9-,10-/m1/s1 |
SMILES |
[C@]12([C@@H](C(=C)CC1)C2)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
Plantae | Annonaceae | Monodora myristica  | Ref. |
Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
Plantae | Annonaceae | Xylopia parviflora  | Ref. |
Plantae | Annonaceae | Xylopia rubescens | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
Plantae | Aristolochiaceae | Asarum heterotropoides var.mandshuricum | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Centaurea orientalis | Ref. |
Plantae | Asteraceae | Petasites albus  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Porophyllum gracile | Ref. |
Plantae | Asteraceae | Porophyllum ruderale  | Ref. |
Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
Plantae | Asteraceae | Senecio vulgaris  | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tanacetum vulgare  | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Hesperis matronalis  | Ref. |
Plantae | Cupressaceae | Juniperus sabina  | Ref. |
Plantae | Fagaceae | Quercus coccifera  | Ref. |
Plantae | Labiatae | Lavandula angustifolia  | Ref. |
Plantae | Labiatae | Lavandula bipinnata  | Ref. |
Plantae | Labiatae | Lavandula dentata  | Ref. |
Plantae | Labiatae | Marrubium vulgare L.  | Ref. |
Plantae | Labiatae | Mentha arvensis L.  | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Satureja subspicata  | Ref. |
Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Pinaceae | Pinus cembra  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Piperaceae | Piper arboreum  | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
Plantae | Rutaceae | Citrus aurantium  | Ref. |
Plantae | Rutaceae | Citrus grandis  | Ref. |
Plantae | Rutaceae | Citrus hystrix  | Ref. |
Plantae | Rutaceae | Citrus latifolia  | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus paradisi  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus retuculata | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Saururaceae | Houttuynia cordata  | Ref. |
Plantae | Solanaceae | Nicotiana alata | Ref. |
Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
Plantae | Solanaceae | Nicotiana mutabilis | Ref. |
Plantae | Zingiberaceae | Alpinia galanga (L.) Sw.  | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
Plantae | Zingiberaceae | Zingiber mioga (Thunberg) Roscoe  | Ref. |
Plantae | Zingiberaceae | Zingiber montanum (Koenig) Theilade  | Ref. |
Plantae | Zingiberaceae | Zingiber officinale ROSC.  | Ref. |
Plantae | Zingiberaceae | Zingiber spectabile Griff. | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Lavandin abrialis | Ref. |
- | - | Trachyspermum roxburghianum  | Ref. |
|
|
zoom in
Organism | Asarum heterotropoides var.mandshuricum | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
---|
|