Name |
Vitexin 8-D-Glucosyl-4',5,7-trihydroxyflavone Apigenin 8-C-glucoside 8-beta-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C21H20O10 |
Mw |
432.10564686 |
CAS RN |
3681-93-4 |
C_ID |
C00001110
,
|
InChIKey |
SGEWCQFRYRRZDC-RJFRUACSNA-N |
InChICode |
InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17+,18-,19+,21-/m0/s1 |
SMILES |
c1(cc(c2c(c1[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O)oc(cc2=O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
Plantae | Araceae | Anthurium versicolor | Ref. |
Plantae | Cannabaceae | Humulus japonicus | Ref. |
Plantae | Caryophyllaceae | Lychnis flos-cuculi L. | Ref. |
Plantae | Caryophyllaceae | Silene brahuica | Ref. |
Plantae | Caryophyllaceae | Silene multijida | Ref. |
Plantae | Caryophyllaceae | Silene repens | Ref. |
Plantae | Caryophyllaceae | Silene supina | Ref. |
Plantae | Caryophyllaceae | Silene turgida | Ref. |
Plantae | Chloranthaceae | Ascarina lucida | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hombroniana | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia purpurea | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia vitiens | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus | Ref. |
Plantae | Combretaceae | Combretum quadrangulare | Ref. |
Plantae | Commelinaceae | Commelina communis L | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Cucurbitaceae | Gynostemma pentaphyllum | Ref. |
Plantae | Cyatheaceae | Cyathea spp. | Ref. |
Plantae | Cyperaceae | Kyllinga brevifolia | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Euphorbiaceae | Euphorbia supina Rafin | Ref. |
Plantae | Fabaceae | Acacia furcatispina | Ref. |
Plantae | Fabaceae | Acacia praecox | Ref. |
Plantae | Fabaceae | Anthyllis subsimplex | Ref. |
Plantae | Fabaceae | Crotalaria micans | Ref. |
Plantae | Fabaceae | Crotalaria pallida | Ref. |
Plantae | Fabaceae | Crotalaria rotundifolia | Ref. |
Plantae | Fabaceae | Crotalaria verrucosa | Ref. |
Plantae | Fabaceae | Cytisus eriocarpus | Ref. |
Plantae | Fabaceae | Cytisus hirsutus | Ref. |
Plantae | Fabaceae | Cytisus scoparius | Ref. |
Plantae | Fabaceae | Desmodium triflorum | Ref. |
Plantae | Fabaceae | Galactia glaucophylla | Ref. |
Plantae | Fabaceae | Gleditsia japonica | Ref. |
Plantae | Fabaceae | Gleditsia sinensis | Ref. |
Plantae | Fabaceae | Gleditsia triacanthos | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza echinata | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Fabaceae | Lespedeza cuneata | Ref. |
Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
Plantae | Fabaceae | Lespedeza juncea | Ref. |
Plantae | Fabaceae | Lespedeza spp. | Ref. |
Plantae | Fabaceae | Lupinus arboreus | Ref. |
Plantae | Fabaceae | Lupinus sericeus | Ref. |
Plantae | Fabaceae | Lupinus subcarnosus | Ref. |
Plantae | Fabaceae | Lupinus texensis | Ref. |
Plantae | Fabaceae | Medicago medicaginoides | Ref. |
Plantae | Fabaceae | Onobrychis angustifolia | Ref. |
Plantae | Fabaceae | Ononis spinosa | Ref. |
Plantae | Fabaceae | Parkinsonia aculeata | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Prosopis alba | Ref. |
Plantae | Fabaceae | Prosopis argentina | Ref. |
Plantae | Fabaceae | Prosopis chilensis | Ref. |
Plantae | Fabaceae | Prosopis fiebrigii | Ref. |
Plantae | Fabaceae | Prosopis hassleri | Ref. |
Plantae | Fabaceae | Prosopis kuntzei | Ref. |
Plantae | Fabaceae | Prosopis nigra | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Prosopis ruscifolia | Ref. |
Plantae | Fabaceae | Prosopis spp. | Ref. |
Plantae | Fabaceae | Prosopis strombulifera | Ref. |
Plantae | Fabaceae | Prosopis vinalillo | Ref. |
Plantae | Fabaceae | Rhynchosia beddomei | Ref. |
Plantae | Fabaceae | Rhynchosia cana | Ref. |
Plantae | Fabaceae | Rhynchosia capitata | Ref. |
Plantae | Fabaceae | Rhynchosia heynei | Ref. |
Plantae | Fabaceae | Rhynchosia jacobii | Ref. |
Plantae | Fabaceae | Rhynchosia minima | Ref. |
Plantae | Fabaceae | Rhynchosia rufescens | Ref. |
Plantae | Fabaceae | Rhynchosia suaveolens | Ref. |
Plantae | Fabaceae | Spartium junceum | Ref. |
Plantae | Fabaceae | Tamarindus indica | Ref. |
Plantae | Fabaceae | Trigonella balansae | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Trigonella grandiflora | Ref. |
Plantae | Fabaceae | Vigna mungo | Ref. |
Plantae | Fabaceae | Vigna radiata | Ref. |
Plantae | Fabaceae | Vigna trilobata | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Labiatae | Isodon oresbia | Ref. |
Plantae | Labiatae | Isodon oresbius | Ref. |
Plantae | Labiatae | Salvia blepharophylla | Ref. |
Plantae | Labiatae | Stachys scardica Griseb. | Ref. |
Plantae | Labiatae | Vitex littoralis | Ref. |
Plantae | Labiatae | Vitex lucens | Ref. |
Plantae | Labiatae | Vitex polygama | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Oxalidaceae | Oxalis corniculata | Ref. |
Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
Plantae | Pinaceae | Larix spp. | Ref. |
Plantae | Poaceae | Pennisetum americanum | Ref. |
Plantae | Ranunculaceae | Adonis spp. | Ref. |
Plantae | Ranunculaceae | Trollius chinensis | Ref. |
Plantae | Ranunculaceae | Trollius ledebouri | Ref. |
Plantae | Ranunculaceae | Trollius macropetalus | Ref. |
Plantae | Rosaceae | Crataegus hupehensis | Ref. |
Plantae | Rosaceae | Crataegus kansuensis | Ref. |
Plantae | Rosaceae | Crataegus maximowiczii | Ref. |
Plantae | Rosaceae | Crataegus oxyacantha | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.major | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.pilosula | Ref. |
Plantae | Rosaceae | Crataegus sanguinea | Ref. |
Plantae | Rosaceae | Crataegus scabrifolia | Ref. |
Plantae | Rosaceae | Physocarpus capitatus | Ref. |
Plantae | Smilacaceae | Smilax bracteata | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE | Ref. |
Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
|
|
zoom in
Organism | Trollius macropetalus | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Liu, et al., APS, 27, (1992), 837.
Shang, et al., CCMM, 23, (1998), 614.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Xiang, et al., Phytochemistry, 65, (2004), 1173.
McNally, et al., JNP, 66, (2003), 1280.
Deachathai, et al., Phytochemistry, 66, (2005), 2368.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|