Name |
(+)-alpha-Pinene alpha-Pinene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
80-56-8 |
C_ID |
C00000805
, 
|
InChIKey |
GRWFGVWFFZKLTI-UHFFFAOYNA-N |
InChICode |
InChI=1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9-/m0/s1 |
SMILES |
C1=C([C@@H]2C[C@H](C1)C2(C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Feces) | Ref. |
Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
Fungi | Trichocomaceae | Penicillium expansum | Ref. |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Anacardium occidentale  | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Anacardiaceae | Pistacia vera  | Ref. |
Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
Plantae | Annonaceae | Cananga odorata  | Ref. |
Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
Plantae | Annonaceae | Monodora myristica  | Ref. |
Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
Plantae | Annonaceae | Xylopia cayennensis  | Ref. |
Plantae | Annonaceae | Xylopia frutescens  | Ref. |
Plantae | Annonaceae | Xylopia parviflora  | Ref. |
Plantae | Annonaceae | Xylopia rubescens | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
Plantae | Apiaceae | Cuminum cyminum L.  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Ferula hermonis  | Ref. |
Plantae | Apiaceae | Ferula iliensis | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
Plantae | Apiaceae | Notopterygium incisum  | Ref. |
Plantae | Apiaceae | Saposhnikovia divaricata | Ref. |
Plantae | Aristolochiaceae | Asarum heterotropoides var.mandshuricum | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
Plantae | Asteraceae | Ambrosia artemisiifolia | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Artemisia capillaris  | Ref. |
Plantae | Asteraceae | Artemisia scoparia  | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Centaurea orientalis | Ref. |
Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
Plantae | Asteraceae | Conyza newii  | Ref. |
Plantae | Asteraceae | Dittrichia graveolens  | Ref. |
Plantae | Asteraceae | Eupatorium bupleurifolium | Ref. |
Plantae | Asteraceae | Helichrysum italicum  | Ref. |
Plantae | Asteraceae | Petasites albus  | Ref. |
Plantae | Asteraceae | Petasites hybridus  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Porophyllum gracile | Ref. |
Plantae | Asteraceae | Porophyllum ruderale  | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
Plantae | Asteraceae | Senecio vulgaris  | Ref. |
Plantae | Asteraceae | Solidago canadensis | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tanacetum vulgare  | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
Plantae | Cannabaceae | Cannabis inflorescences | Ref. |
Plantae | Cannabaceae | Humulus lupulus  | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica  | Ref. |
Plantae | Caryophyllaceae | Silene latifolia  | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cistaceae | Cistus clusii | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Hesperis matronalis  | Ref. |
Plantae | Cupressaceae | Cupressus tricuspidata | Ref. |
Plantae | Cupressaceae | Neocallitropsis pancheri | Ref. |
Plantae | Cupressaceae | Thuja orientalis  | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
Plantae | Ericaceae | Rhododendron capitatum | Ref. |
Plantae | Fabaceae | Trifolium repens L.  | Ref. |
Plantae | Fagaceae | Quercus coccifera  | Ref. |
Plantae | Gymnomitriaceae | Marsupella alpina | Ref. |
Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
Plantae | Jubulaceae | Frullania monocera | Ref. |
Plantae | Jubulaceae | Frullania spinifera | Ref. |
Plantae | Jungermanniaceae | Jungermannia truncata NEES | Ref. |
Plantae | Labiatae | Agastache rugosus | Ref. |
Plantae | Labiatae | Hyssopus cuspidatus | Ref. |
Plantae | Labiatae | Lavandula angustifolia  | Ref. |
Plantae | Labiatae | Lavandula bipinnata  | Ref. |
Plantae | Labiatae | Lavandula canarien-sis | Ref. |
Plantae | Labiatae | Lavandula dentata  | Ref. |
Plantae | Labiatae | Lavandula gibsoni | Ref. |
Plantae | Labiatae | Lavandula multifida  | Ref. |
Plantae | Labiatae | Lavandula stoechas  | Ref. |
Plantae | Labiatae | Marrubium vulgare L.  | Ref. |
Plantae | Labiatae | Mentha haplocalyx  | Ref. |
Plantae | Labiatae | Ocimum americanum  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Ocimum gratissimum  | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum  | Ref. |
Plantae | Labiatae | Perilla frutescens var.acuta  | Ref. |
Plantae | Labiatae | Perilla frutescens var.crispa  | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Salvia officinalis  | Ref. |
Plantae | Labiatae | Satureja subspicata  | Ref. |
Plantae | Labiatae | Schizonepeta tenuifolia  | Ref. |
Plantae | Labiatae | Tetradenia riparia  | Ref. |
Plantae | Labiatae | Thymus X-porlock | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Labiatae | Thymus eriocalyx | Ref. |
Plantae | Labiatae | Thymus piperella  | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Labiatae | Trichostema lanceolatum | Ref. |
Plantae | Labiatae | Vitex negundo  | Ref. |
Plantae | Labiatae | Vitex rotundifolia  | Ref. |
Plantae | Lamiaceae | Acinos rotundifolius | Ref. |
Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens  | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Laurus nobilis  | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Lauraceae | Ocotea floribunda | Ref. |
Plantae | Lauraceae | Ocotea holdrigeana | Ref. |
Plantae | Lauraceae | Ocotea sinuata | Ref. |
Plantae | Lauraceae | Ocotea tonduzii | Ref. |
Plantae | Lauraceae | Ocotea whitei | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
Plantae | Meliaceae | Melia azadirach | Ref. |
Plantae | Myristicaceae | Myristica fragrans  | Ref. |
Plantae | Myrtaceae | Eucalyptus aggregata | Ref. |
Plantae | Myrtaceae | Eucalyptus alba | Ref. |
Plantae | Myrtaceae | Eucalyptus blakelyi | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis  | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
Plantae | Myrtaceae | Eucalyptus deglupta  | Ref. |
Plantae | Myrtaceae | Eucalyptus dives  | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus var. bicostata  | Ref. |
Plantae | Myrtaceae | Eucalyptus grandis  | Ref. |
Plantae | Myrtaceae | Eucalyptus microcorys | Ref. |
Plantae | Myrtaceae | Eucalyptus microtheca  | Ref. |
Plantae | Myrtaceae | Eucalyptus nitens | Ref. |
Plantae | Myrtaceae | Eucalyptus pellita  | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus robusta | Ref. |
Plantae | Myrtaceae | Eucalyptus saligna  | Ref. |
Plantae | Myrtaceae | Eucalyptus sideroxylon | Ref. |
Plantae | Myrtaceae | Eucalyptus tereticornis  | Ref. |
Plantae | Myrtaceae | Eucalyptus torelliana | Ref. |
Plantae | Myrtaceae | Eugenia zuchowskiae | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
Plantae | Myrtaceae | Melaleuca alternifolia  | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Oleaceae | Forsythia suspensa  | Ref. |
Plantae | Pinaceae | Abies grandis | Ref. |
Plantae | Pinaceae | Cedrus libani  | Ref. |
Plantae | Pinaceae | Larix sibirica | Ref. |
Plantae | Pinaceae | Picea ajanensis | Ref. |
Plantae | Pinaceae | Picea glehnii L. | Ref. |
Plantae | Pinaceae | Picea koraiensis | Ref. |
Plantae | Pinaceae | Picea obovata | Ref. |
Plantae | Pinaceae | Picea schrenkiana | Ref. |
Plantae | Pinaceae | Pinus banksiana  | Ref. |
Plantae | Pinaceae | Pinus cembra  | Ref. |
Plantae | Pinaceae | Pinus contorta var. latifolia  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus massoniana | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
Plantae | Pinaceae | Pinus palustris  | Ref. |
Plantae | Pinaceae | Pinus sibirica L. | Ref. |
Plantae | Pinaceae | Pinus sylvestris L.  | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Piperaceae | Piper arboreum  | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Piperaceae | Piper obliquum  | Ref. |
Plantae | Poaceae | Capillipedium parviflorum | Ref. |
Plantae | Poaceae | Cymbopogon citratus  | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
Plantae | Rosaceae | Fragaria vesca  | Ref. |
Plantae | Rutaceae | Citrofortunella mitis | Ref. |
Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
Plantae | Rutaceae | Citrus aurantium  | Ref. |
Plantae | Rutaceae | Citrus deliciosa | Ref. |
Plantae | Rutaceae | Citrus grandis  | Ref. |
Plantae | Rutaceae | Citrus hystrix  | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus paradisi  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Citrus unshiu  | Ref. |
Plantae | Rutaceae | Murraya exotica  | Ref. |
Plantae | Rutaceae | Murraya paniculata  | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
Plantae | Rutaceae | Zanthoxylum leprieurii  | Ref. |
Plantae | Saururaceae | Anemopsis californica | Ref. |
Plantae | Saururaceae | Houttuynia cordata Thunb.  | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
Plantae | Solanaceae | Nicotiana alata | Ref. |
Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
Plantae | Solanaceae | Nicotiana mutabilis | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Solanaceae | Solanum peruvianum | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansii  | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis var.latifolia  | Ref. |
Plantae | Verbenaceae | Lippia javanica  | Ref. |
Plantae | Verbenaceae | Lippia multiflora  | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Zingiberaceae | Aframomum melegueta  | Ref. |
Plantae | Zingiberaceae | Alpinia officinarum  | Ref. |
Plantae | Zingiberaceae | Amomum medium | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza  | Ref. |
Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
Plantae | Zingiberaceae | Zingiber mioga (Thunberg) Roscoe  | Ref. |
Plantae | Zingiberaceae | Zingiber montanum (Koenig) Theilade  | Ref. |
Plantae | Zingiberaceae | Zingiber officinale ROSC.  | Ref. |
Plantae | Zingiberaceae | Zingiber spectabile Griff. | Ref. |
Plantae | Zingiberaceae | Zingiber zerumbet Smith  | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L.  | Ref. |
- | - | Burkholderia tropica | Ref. |
- | - | Gackstroemia magellanica | Ref. |
- | - | Lavandin abrialis | Ref. |
- | - | Marjorana hortensis | Ref. |
- | - | Spongiporus leucomallellus (Murril) | Ref. |
- | - | Trachyspermum roxburghianum  | Ref. |
|
|
zoom in
Organism | Vitex rotundifolia | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Xie, et al., Chapter 28, JIU LI XIANG, in Modern Stydies of Chinese Herbal Medicine, edited. By Institute of Materia Medica, Chinese Academy of Medical Sciences, Vol.2, 333-61, Union Press of Beijing Medical University and Peking Union Medical College, Geijing, (1996).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|