| Name |
Osajin |
| Formula |
C25H24O5 |
| Mw |
404.16237388 |
| CAS RN |
482-53-1 |
| C_ID |
C00002555
, 
|
| InChIKey |
DCTLJGWMHPGCOS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H24O5/c1-14(2)5-10-17-21(27)20-22(28)19(15-6-8-16(26)9-7-15)13-29-24(20)18-11-12-25(3,4)30-23(17)18/h5-9,11-13,26-27H,10H2,1-4H3 |
| SMILES |
c12c(c(c3c(c1C=CC(O2)(C)C)occ(c3=O)c1ccc(cc1)O)O)CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Deguelia hatschbachii | Ref. |
| Plantae | Fabaceae | Derris scandens | Ref. |
| Plantae | Fabaceae | Erythrina orientalis | Ref. |
| Plantae | Fabaceae | Erythrina variegata | Ref. |
| Plantae | Fabaceae | Erythrina variegatav | Ref. |
| Plantae | Fabaceae | Euchresta strigillosa | Ref. |
| Plantae | Moraceae | Maclura pomifera | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Maclura pomifera |
|---|
| Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Mizuno, et al., Phytochemistry, 29, (1990), 2663
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter38 |
|---|
|
