| Name |
Zaluzanin C |
| Formula |
C15H18O3 |
| Mw |
246.12559444 |
| CAS RN |
16838-87-2 |
| C_ID |
C00003397
, 
|
| InChIKey |
XFVLNEYIZGZDHP-JQXIRTQVNA-N |
| InChICode |
InChI=1S/C15H18O3/c1-7-4-5-10-8(2)15(17)18-14(10)13-9(3)12(16)6-11(7)13/h10-14,16H,1-6H2/t10-,11-,12-,13-,14-/m0/s1 |
| SMILES |
[C@@H]12[C@@H]([C@@H]3[C@@H](CCC1=C)C(=C)C(=O)O3)C(=C)[C@H](C2)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ainsliaea fragrans | Ref. |
| Plantae | Asteraceae | Ixeris dentata Nakai | Ref. |
| Plantae | Asteraceae | Onopordon laconicum | Ref. |
| Plantae | Asteraceae | Podachaenium eminens | Ref. |
| Plantae | Asteraceae | Saussurea lappa  | Ref. |
| Plantae | Asteraceae | Urospermum dalechampii (L.) F.W.Schmidt | Ref. |
| Plantae | Asteraceae | Vernonia spp. | Ref. |
| Plantae | Asteraceae | Youngia japonica (L.) DC. | Ref. |
| Plantae | Asteraceae | Zaluzania angusta | Ref. |
| Plantae | Asteraceae | Zaluzania spp. | Ref. |
| Plantae | Asteraceae | Zinnia acerosa | Ref. |
| Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
| Plantae | Lauraceae | Laurus nobilis L. | Ref. |
|
|
zoom in
| Organism | Conocephalum conicum |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Sun, et al., JNP, 66, (2003), 1175 |
|---|
|
