Name |
Quercetagetin 7-glucoside |
Formula |
C21H20O13 |
Mw |
480.09039073 |
CAS RN |
548-75-4 |
C_ID |
C00005633
,
|
InChIKey |
IDTDRZPBDLMCLB-BNLZDKBQNA-N |
InChICode |
InChI=1S/C21H20O13/c22-5-11-14(26)17(29)19(31)21(34-11)33-10-4-9-12(15(27)13(10)25)16(28)18(30)20(32-9)6-1-2-7(23)8(24)3-6/h1-4,11,14,17,19,21-27,29-31H,5H2/t11-,14-,17+,19-,21-/m1/s1 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Chrysactinia mexicana | Ref. |
Plantae | Asteraceae | Chrysanthemum spp. | Ref. |
Plantae | Asteraceae | Clibadium spp. | Ref. |
Plantae | Asteraceae | Coreopsis spp. | Ref. |
Plantae | Asteraceae | Desmanthodium perfoliatum | Ref. |
Plantae | Asteraceae | Glossopappus macrotus | Ref. |
Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
Plantae | Asteraceae | Lepidophorum repandum | Ref. |
Plantae | Asteraceae | Leucanthemopsis flaveola | Ref. |
Plantae | Asteraceae | Tagetes erecta | Ref. |
Plantae | Asteraceae | Tetragonotheca texana | Ref. |
- | - | Nerolaena spp. | Ref. |
|
|
zoom in
Organism | Nerolaena spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Rao,Proc.Indian Acad.Sci.Sect.A.,14,(1941),289
Harborne,Biochem.Syst.Ecol.,4,(1976),1 |
---|
|