Name |
Myricitrin Myricetin 3-O-alpha-L-rhamnopyranoside Myricetin 3-O-alpha-L-rhamnoside Myricetin 3-O-rhamnoside Myricetin 3-rhamnoside |
Formula |
C21H20O12 |
Mw |
464.09547611 |
CAS RN |
17912-87-7 |
C_ID |
C00005730
, 
|
InChIKey |
DCYOADKBABEMIQ-UXDHSYMWNA-N |
InChICode |
InChI=1S/C21H20O12/c1-6-14(26)17(29)18(30)21(31-6)33-20-16(28)13-9(23)4-8(22)5-12(13)32-19(20)7-2-10(24)15(27)11(25)3-7/h2-6,14,17-18,21-27,29-30H,1H3/t6-,14-,17+,18-,21-/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)C)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Pistacia weinmannifolia J.Pisson ex.Franch  | Ref. |
Plantae | Anacardiaceae | Rhus parviflora  | Ref. |
Plantae | Asteraceae | Haplopappus bailahuen | Ref. |
Plantae | Canellaceae | Warburgia stuhlmannii  | Ref. |
Plantae | Caricaceae | Carica papaya  | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
Plantae | Cunoniaceae | Davidsonia pruriens  | Ref. |
Plantae | Dilleniaceae | Doliocarpus spraguei  | Ref. |
Plantae | Fabaceae | Acacia aroma  | Ref. |
Plantae | Fabaceae | Acacia saligna | Ref. |
Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
Plantae | Fabaceae | Desmanthus illinoensis | Ref. |
Plantae | Fabaceae | Flemingia congesta | Ref. |
Plantae | Fabaceae | Vicia faba  | Ref. |
Plantae | Fagaceae | Quercus rubra  | Ref. |
Plantae | Iridaceae | Patersonia spp. | Ref. |
Plantae | Juglandaceae | Juglans mandshurica | Ref. |
Plantae | Leeaceae | Leea thorelii Gagnep | Ref. |
Plantae | Myricaceae | Myrica rubra  | Ref. |
Plantae | Myrsinaceae | Lysimachia spp. | Ref. |
Plantae | Myrtaceae | Eugenia edulis  | Ref. |
Plantae | Myrtaceae | Luma chequen  | Ref. |
Plantae | Myrtaceae | Plinia pinnata | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Nymphaeaceae | Nymphaea lotus  | Ref. |
Plantae | Nymphaeaceae | Nymphaea odorata  | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
Plantae | Pinaceae | Abies amabilis | Ref. |
Plantae | Plumbaginaceae | Armeria sp. | Ref. |
Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
Plantae | Plumbaginaceae | Limonium spp. | Ref. |
Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
Plantae | Restionaceae | Chondropetalum spp. | Ref. |
Plantae | Restionaceae | Elegia capensis | Ref. |
Plantae | Sapotaceae | Diploknema butyracea | Ref. |
Plantae | Sapotaceae | Manilkara zapota cv.Tikal  | Ref. |
Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
Plantae | Saxifragaceae | Heuchera spp. | Ref. |
Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
Plantae | Taxodiaceae | Metasequoia glyptostroboides | Ref. |
Plantae | Zingiberaceae | Hedychium spp. | Ref. |
- | - | Peltiphyllum peltatum | Ref. |
- | - | Sarcolaeana multiflora | Ref. |
|
|
zoom in
Organism | Caesalpinia pulcherrima | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Shibata,J.Am.Chem.Soc.,41,(1919),208
Zapesochnaya,Khim.Prir.Soedin.,(1982),695 |
---|
|