Name |
Pinobanksin |
Formula |
C15H12O5 |
Mw |
272.06847349 |
CAS RN |
548-82-3 |
C_ID |
C00000991
,
|
InChIKey |
SUYJZKRQHBQNCA-PVRQQBJHNA-N |
InChICode |
InChI=1S/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H]([C@H](C2=O)O)c1ccccc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Akaniaceae | Bretschneidera sinensis | Ref. |
Plantae | Asteraceae | Baccharis bigelovii | Ref. |
Plantae | Asteraceae | Baccharis oxydonta | Ref. |
Plantae | Asteraceae | Chromolaena chasleae | Ref. |
Plantae | Asteraceae | Flourensia riparia Grisebach | Ref. |
Plantae | Asteraceae | Helichrysum tenuifolium | Ref. |
Plantae | Asteraceae | Lychnophora diamantinana | Ref. |
Plantae | Betulaceae | Alnus sieboldiana | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Malvaceae | Tilia platyphyllos | Ref. |
Plantae | Myoporaceae | Eremophila alternifolia | Ref. |
Plantae | Myoporaceae | Eremophila spp. | Ref. |
Plantae | Orchidaceae | Bulbophyllum odoratissimum | Ref. |
Plantae | Pinaceae | Larix dahurica | Ref. |
Plantae | Pinaceae | Pinus banksiana | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Platanaceae | Platanus vulgaris | Ref. |
Plantae | Polygonaceae | Polygonum nodosum | Ref. |
Plantae | Salicaceae | Populus deltoides | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
Organism | Bulbophyllum odoratissimum | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Kuroyanagi, et al., Chem Pharm Bull, 30, (1982), 1602.
Majumder, et al., Phytochemistry, 30, (1991), 2092.
Ma, et al., Zhiwu Xuebao, 34, (1992), 483
Harborne, The Handbook of Natural Flavonoids, 2, (1999), 662,Flavanones and dihydroflavonols
Lindstedt,Acta Chem.Scand.,5,(1951),121
Majumder,Phytochem.,30,(1991),2092 |
---|
|