Name |
Sakuranetin 5,4'-Dihydroxy-7-methoxyflavanone Naringenin 7-O-methyl ether |
Formula |
C16H14O5 |
Mw |
286.08412356 |
CAS RN |
2957-21-3 |
C_ID |
C00000999
, 
|
InChIKey |
DJOJDHGQRNZXQQ-YQTOOIBONA-N |
InChICode |
InChI=1S/C16H14O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1ccc(cc1)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia campestris  | Ref. |
Plantae | Asteraceae | Baccharis spp. | Ref. |
Plantae | Asteraceae | Polymnia fruticosa | Ref. |
Plantae | Betulaceae | Betula spp. | Ref. |
Plantae | Celastraceae | Microtropis japonica | Ref. |
Plantae | Fabaceae | Mimosa hostilis | Ref. |
Plantae | Juglandaceae | Juglans spp.  | Ref. |
Plantae | Piperaceae | Piper crassinervium Kunth | Ref. |
Plantae | Piperaceae | Piper lhotzkyanum | Ref. |
Plantae | Poaceae | Oryza sativa  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rosaceae | Prunus cerasus  | Ref. |
Plantae | Rosaceae | Prunus spp.  | Ref. |
Plantae | Xanthorrhoeaceae | Xanthorrhoea hastilis  | Ref. |
Plantae | Zingiberaceae | Boesenbergia rotunda (L.) Mansf.Kulturpfl.  | Ref. |
|
|
zoom in
Organism | Prunus spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 323,Flavanones and dihydroflavonols
Asahina,J.Pharm.Soc.Jpn.,(1908),213
Kodama,Phytochem.,31,(1992),3807 |
---|
|