| Name |
Nevadensin |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
10176-66-6 |
| C_ID |
C00001075
, 
|
| InChIKey |
KRFBMPVGAYGGJE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-10-6-4-9(5-7-10)12-8-11(19)13-14(20)17(23-2)15(21)18(24-3)16(13)25-12/h4-8,20-21H,1-3H3 |
| SMILES |
c1(c(c(c2c(c1OC)oc(cc2=O)c1ccc(cc1)OC)O)OC)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Acanthopanax trifoliatus  | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Baccharis grisebachii | Ref. |
| Plantae | Asteraceae | Helianthus spp. | Ref. |
| Plantae | Asteraceae | Iva nevadensis | Ref. |
| Plantae | Asteraceae | Madia capitata | Ref. |
| Plantae | Asteraceae | Simsia cronquistii | Ref. |
| Plantae | Asteraceae | Tithonia calva | Ref. |
| Plantae | Asteraceae | Viguiera rosei | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Fabaceae | Ononis natrix | Ref. |
| Plantae | Gesneriaceae | Lysionotus pauciflora | Ref. |
| Plantae | Labiatae | Hyptis albida | Ref. |
| Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton | Ref. |
| Plantae | Labiatae | Ocimum basilicum L. | Ref. |
| Plantae | Labiatae | Ocimum canum | Ref. |
| Plantae | Labiatae | Ocimum minimum L. | Ref. |
| Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
| Plantae | Rosaceae | Rosa centifolia | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
| Plantae | Tamaricaceae | Tamarix dioica | Ref. |
|
|
zoom in
| Organism | Hyptis albida |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Farkas,J.Org.Chem.,31,(1966),3228
Barrero,Phytochem.,29,(1990),1967 |
|---|
|
