Name |
Procyanidin A2 Proanthocyanidin A-2 (+)-Proanthocyanidin A-2 Proanthocyanidin A2 |
Formula |
C30H24O12 |
Mw |
576.12677623 |
CAS RN |
41743-41-3 |
C_ID |
C00002934
,
|
InChIKey |
NSEWTSAADLNHNH-JIZSURFONA-N |
InChICode |
InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26-,27-,29-,30+/m1/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@]1([C@@H]([C@H]2c2c3c(c(cc2O1)O)C[C@H]([C@H](O3)c1cc(c(cc1)O)O)O)O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apocynaceae | Ecdysanthera utilis | Ref. |
Plantae | Apocynaceae | Parameria laevigata MOLDENKE | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Fabaceae | Arachis hypogaea L. | Ref. |
Plantae | Lauraceae | Cinnamomum aromaticum | Ref. |
Plantae | Lauraceae | Cinnamomum spp. | Ref. |
Plantae | Lauraceae | Persea gratissima | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Cola acuminata | Ref. |
Plantae | Rosaceae | Malus sylvestris | Ref. |
Plantae | Rosaceae | Rhaphiolepis umbellata | Ref. |
Plantae | Rubiaceae | Pavetta owariensis | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
- | - | Cinnamomi sp. | Ref. |
|
|
zoom in
Organism | Pavetta owariensis | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Weinges,Ann.,715,(1968),164
Jacques,J.Chem.Soc.Perkin Trans.,1,(1974),2663 |
---|
|