Name |
cis-Citral (Z)-Citral beta-Citral Neral Citral Z |
Formula |
C10H16O |
Mw |
152.12011513 |
CAS RN |
106-26-3 |
C_ID |
C00003036
, 
|
InChIKey |
WTEVQBCEXWBHNA-YFHOEESVSA-N |
InChICode |
InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7- |
SMILES |
CC(=CCC/C(=C\C=O)/C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Xylopia sericea  | Ref. |
Plantae | Asteraceae | Conyza newii  | Ref. |
Plantae | Asteraceae | Senecio vulgaris  | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
Plantae | Labiatae | Dracocephalum kotschyi  | Ref. |
Plantae | Labiatae | Lavandula canarien-sis | Ref. |
Plantae | Labiatae | Melissa officinalis  | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Lauraceae | Litsea verbena | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus gomphocephala | Ref. |
Plantae | Piperaceae | Piper cubeba  | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Poaceae | Cymbopogon citratus  | Ref. |
Plantae | Poaceae | Cymbopogon flexuosus  | Ref. |
Plantae | Rutaceae | Citrus latifolia  | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus medica  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
Plantae | Solanaceae | Nicotiana tobacum | Ref. |
Plantae | Verbenaceae | Verbena triphylla | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
Organism | Piper cubeba | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Saeidnia, et al., Chem Pharm Bull, 52, (2004), 1249.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
---|
|