| Name |
4'-Hydroxywogonin
Isoscutellarein 8-methyl ether
5,7,4'-Trihydroxy-8-methoxyflavone
8-Methoxyapigenin |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
57096-02-3 |
| C_ID |
C00003850
, 
|
| InChIKey |
OEZZJTAJYYSQKM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-15-12(20)6-10(18)14-11(19)7-13(22-16(14)15)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
| SMILES |
c1(cc(c2c(c1OC)oc(cc2=O)c1ccc(cc1)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asteraceae | Centaurea chilensis | Ref. |
| Plantae | Asteraceae | Centaurea cineraria L. | Ref. |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Doronicum grandiflorum | Ref. |
| Plantae | Asteraceae | Madia spp. | Ref. |
| Plantae | Asteraceae | Wilkesia hobdyi | Ref. |
| Plantae | Asteraceae | Zinnia acerosa | Ref. |
| Plantae | Chrysobalanaceae | Licania densiflora | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia andamanica | Ref. |
| Plantae | Labiatae | Scutellaria amabilis HARA | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis | Ref. |
| Plantae | Labiatae | Scutellaria barbata | Ref. |
| Plantae | Labiatae | Scutellaria discolor | Ref. |
| Plantae | Labiatae | Scutellaria indica | Ref. |
| Plantae | Labiatae | Scutellaria repens | Ref. |
| Plantae | Labiatae | Scutellaria scrzonerifolium | Ref. |
| Plantae | Rubiaceae | Gardenia gummifera | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
| Plantae | Verbenaceae | Verbena littoralis | Ref. |
|
|
zoom in
| Organism | Scutellaria barbata |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chang, et al., Phytochemistry, 64, (2003), 1375.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|
