Name |
Xanthomicrol 5-Hydroxy-2-(4-hydroxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
Formula |
C18H16O7 |
Mw |
344.08960287 |
CAS RN |
16545-23-6 |
C_ID |
C00003879
, 
|
InChIKey |
SAMBWAJRKKEEOR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O7/c1-22-16-14(21)13-11(20)8-12(9-4-6-10(19)7-5-9)25-15(13)17(23-2)18(16)24-3/h4-8,19,21H,1-3H3 |
SMILES |
c1(c(c(c2c(c1OC)oc(cc2=O)c1ccc(cc1)O)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ambrosia deltoidea | Ref. |
Plantae | Asteraceae | Baccharis patens | Ref. |
Plantae | Asteraceae | Bracteantha viscosa | Ref. |
Plantae | Asteraceae | Helichrysum spp. | Ref. |
Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
Plantae | Asteraceae | Varthemia iphionoides  | Ref. |
Plantae | Fabaceae | Ononis natrix  | Ref. |
Plantae | Labiatae | Cunila angustifolia | Ref. |
Plantae | Labiatae | Cunila incana | Ref. |
Plantae | Labiatae | Mentha piperita  | Ref. |
Plantae | Labiatae | Nepeta spp. | Ref. |
Plantae | Labiatae | Ocimum americanum L.var.americanum  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Ocimum gratissimum  | Ref. |
Plantae | Labiatae | Satureja douglasii | Ref. |
Plantae | Labiatae | Satureja montana  | Ref. |
Plantae | Labiatae | Sideritis dasygnaphala | Ref. |
Plantae | Labiatae | Sideritis spp. | Ref. |
Plantae | Labiatae | Thymus herba-barona  | Ref. |
Plantae | Labiatae | Thymus spp. | Ref. |
Plantae | Phytolaccaceae | Phytolacca americana  | Ref. |
Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
Plantae | Rutaceae | Citrus sudachi  | Ref. |
Plantae | Rutaceae | Citrus sudachii | Ref. |
|
|
zoom in
Organism | Ocimum basilicum | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
|
---|
|