Name |
7-O-methylamentoflavone Sequoiaflavone |
Formula |
C31H20O10 |
Mw |
552.10564686 |
CAS RN |
21763-71-3 |
C_ID |
C00006487
,
|
InChIKey |
TYUMAYSMJLPFAN-UHFFFAOYSA-N |
InChICode |
InChI=1S/C31H20O10/c1-39-17-9-20(34)29-23(37)12-26(40-27(29)10-17)15-4-7-19(33)18(8-15)28-21(35)11-22(36)30-24(38)13-25(41-31(28)30)14-2-5-16(32)6-3-14/h2-13,32-36H,1H3 |
SMILES |
c1c(c(ccc1c1oc2c(c(=O)c1)c(cc(c2)OC)O)O)c1c(cc(c2c1oc(cc2=O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cephalotaxaceae | Amentotaxus yunnanensis | Ref. |
Plantae | Cephalotaxaceae | Cephalotaxus harringtonia | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cupressaceae | Cupressus cashmeriana | Ref. |
Plantae | Cupressaceae | Libocedrus bidwillii | Ref. |
Plantae | Euphorbiaceae | Elateriospermum tapos | Ref. |
Plantae | Podocarpaceae | Podocarpus montanus | Ref. |
Plantae | Taxodiaceae | Cryptomeria konishii | Ref. |
Plantae | Taxodiaceae | Sequoia sempervirens | Ref. |
Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
Plantae | Zamiaceae | Dioon spp. | Ref. |
Plantae | Zamiaceae | Zamia angustifolia | Ref. |
|
|
zoom in
Organism | Zamia angustifolia | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Miura,J.Pharm.Soc.Japan,88,(1968),1489 |
---|
|