Name |
Trametenolic acid 3beta-Hydroxylanosta-8,24-dien-21-oic acid (+)-Trametenolic acid B |
Formula |
C30H48O3 |
Mw |
456.3603454 |
CAS RN |
24160-36-9 |
C_ID |
C00023783
,
|
InChIKey |
NBSBUIQBEPROBM-HWMAWYSZNA-N |
InChICode |
InChI=1S/C30H48O3/c1-19(2)9-8-10-20(26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h9,20-21,24-25,31H,8,10-18H2,1-7H3,(H,32,33)/t20-,21-,24+,25+,28-,29-,30+/m1/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)(C1=C(CC2)[C@]2([C@](CC1)([C@H](CC2)[C@H](C(=O)O)CCC=C(C)C)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Bondarzewiaceae | Heterobasidion tasmanica | Ref. |
Fungi | Fomitopsidaceae | Daedalea trabea | Ref. |
Fungi | Fomitopsidaceae | Fomitopsis pinicola | Ref. |
Fungi | Ganodermataceae | Ganoderma tsugae | Ref. |
Fungi | Gloeophyllaceae | Veluticeps angularis | Ref. |
Fungi | Hymenochaetaceae | Inonotus obliquus | Ref. |
Fungi | Hymenochaetaceae | Phellinus gilvus | Ref. |
Fungi | Hymenochaetaceae | Phellinus gilvus TMC-1117 | Ref. |
Fungi | Polyporaceae | Laetiporus sulphureus | Ref. |
Fungi | Polyporaceae | Lentinus lepideus | Ref. |
Fungi | Polyporaceae | Lenzites trabea | Ref. |
Fungi | Polyporaceae | Trametes odorata | Ref. |
Fungi | Polyporaceae | Tyromyces fissilis | Ref. |
- | - | Fomex senex | Ref. |
- | - | Gloephyllum abietinum | Ref. |
- | - | Gloephyllum odoratum | Ref. |
- | - | Gloephyllum sepiarium | Ref. |
- | - | Gloephyllum striatum | Ref. |
- | - | Gloephyllum trabeum | Ref. |
- | - | Poria cocos | Ref. |
- | - | Spongiporus appendiculatus | Ref. |
|
|
zoom in
Organism | Tyromyces fissilis | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
QUANG, et al., Chem Pharm Bull, 51, (2003), 1441 |
---|
|