Name |
Isoprene |
Formula |
C5H8 |
Mw |
68.06260026 |
CAS RN |
78-79-5 |
C_ID |
C00046784
,
|
InChIKey |
RRHGJUQNOFWUDK-UHFFFAOYSA-N |
InChICode |
InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 |
SMILES |
CC(=C)C=C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
Bacteria | Bacillaceae | Bacillus subtilis 6051 | Ref. |
Plantae | Adoxaceae | Sambucus simponii | Ref. |
Plantae | Adoxaceae | Viburnum rufidulum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Pistacia lentiscus | Ref. |
Plantae | Anacardiaceae | Rhus leptodictya | Ref. |
Plantae | Anacardiaceae | Rhus ovata | Ref. |
Plantae | Anacardiaceae | Schinus molle | Ref. |
Plantae | Anacardiaceae | Schinus terebinthifolius | Ref. |
Plantae | Apocynaceae | Carissa macrocarpa | Ref. |
Plantae | Apocynaceae | Nerium oleander | Ref. |
Plantae | Aquifoliaceae | Ilex cassine | Ref. |
Plantae | Asteraceae | Artemisia californica | Ref. |
Plantae | Asteraceae | Artemisia tridentata | Ref. |
Plantae | Asteraceae | Baccharis texana | Ref. |
Plantae | Asteraceae | Chrysanthemum praecox | Ref. |
Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
Plantae | Asteraceae | Dittrichia viscosa | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Helichrysum stoechas | Ref. |
Plantae | Asteraceae | Xanthocephalum dracuna | Ref. |
Plantae | Berberidaceae | Nandina domestica | Ref. |
Plantae | Betulaceae | Alnus rubra | Ref. |
Plantae | Bignoniaceae | Jacaranda mimosifolia | Ref. |
Plantae | Burseraceae | Bursera simaruba | Ref. |
Plantae | Buxaceae | Buxus sempervirens | Ref. |
Plantae | Capparaceae | Capparis cynophollophora | Ref. |
Plantae | Capparaceae | Capparis indica | Ref. |
Plantae | Cecropiaceae | Myrianthus arboreus | Ref. |
Plantae | Chenopodiaceae | Atriplex canescens | Ref. |
Plantae | Cistaceae | Cistus incanus | Ref. |
Plantae | Cistaceae | Cistus salvifolius | Ref. |
Plantae | Combretaceae | Combretum apiculatum | Ref. |
Plantae | Combretaceae | Combretum molle | Ref. |
Plantae | Combretaceae | Laguncularia racemosa | Ref. |
Plantae | Combretaceae | Terminalia prunoides | Ref. |
Plantae | Combretaceae | Terminalia sericea | Ref. |
Plantae | Combretaceae | Terminalia superba | Ref. |
Plantae | Cornaceae/Nyssaceae | Nyssa spp. | Ref. |
Plantae | Cupressaceae | Juniperus phoenicea | Ref. |
Plantae | Cupressaceae | Thuja plicate | Ref. |
Plantae | Dennstaedtiaceae | Pteridium aquilinum | Ref. |
Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Symphoricarpos occidentalis | Ref. |
Plantae | Ericaceae | Arbutus unedo | Ref. |
Plantae | Ericaceae | Arctostaphylos glauca | Ref. |
Plantae | Ericaceae | Erica arborea | Ref. |
Plantae | Ericaceae | Erica australis | Ref. |
Plantae | Ericaceae | Erica ciliaris | Ref. |
Plantae | Ericaceae | Erica cinerea rose | Ref. |
Plantae | Ericaceae | Erica multiflora | Ref. |
Plantae | Ericaceae | Erica umbellata | Ref. |
Plantae | Ericaceae | Kalmia latifolia | Ref. |
Plantae | Ericaceae | Vaccinium myrtillus | Ref. |
Plantae | Ericaceae | Vaccinium uliginosum | Ref. |
Plantae | Euphorbiaceae | Hevea brasiliensis | Ref. |
Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
Plantae | Fabaceae | Acacia farnesiana | Ref. |
Plantae | Fabaceae | Acacia nigescens | Ref. |
Plantae | Fabaceae | Acacia nigrescens | Ref. |
Plantae | Fabaceae | Acacia tortilis | Ref. |
Plantae | Fabaceae | Afrormosia laxiflora | Ref. |
Plantae | Fabaceae | Albizia ferruginea | Ref. |
Plantae | Fabaceae | Albizia julibrissin | Ref. |
Plantae | Fabaceae | Arachis glabrata | Ref. |
Plantae | Fabaceae | Burkea africana | Ref. |
Plantae | Fabaceae | Colophospermum mopane | Ref. |
Plantae | Fabaceae | Cytisus scoparius | Ref. |
Plantae | Fabaceae | Daniellia oliveri | Ref. |
Plantae | Fabaceae | Detarium microcarpum | Ref. |
Plantae | Fabaceae | Genista scorpius | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Leucaena retusa | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Mucuna pruriens | Ref. |
Plantae | Fabaceae | Mucuna pruriens var. utilis | Ref. |
Plantae | Fabaceae | Pterocarpus luscens | Ref. |
Plantae | Fabaceae | Pterocarpus soyauxii | Ref. |
Plantae | Fabaceae | Pueraria lobata | Ref. |
Plantae | Fabaceae | Robinia pseudoacacia | Ref. |
Plantae | Fabaceae | Spartium junceum | Ref. |
Plantae | Fabaceae | Ulex europaeus | Ref. |
Plantae | Fabaceae | Ulex parviflorus | Ref. |
Plantae | Fagaceae | Castanea dentata | Ref. |
Plantae | Fagaceae | Fagus sylvatica | Ref. |
Plantae | Fagaceae | Quercus agrifolia | Ref. |
Plantae | Fagaceae | Quercus alba | Ref. |
Plantae | Fagaceae | Quercus borealis | Ref. |
Plantae | Fagaceae | Quercus calliprinos | Ref. |
Plantae | Fagaceae | Quercus canariensis | Ref. |
Plantae | Fagaceae | Quercus coccifera | Ref. |
Plantae | Fagaceae | Quercus coccinea | Ref. |
Plantae | Fagaceae | Quercus douglasii | Ref. |
Plantae | Fagaceae | Quercus dumosa | Ref. |
Plantae | Fagaceae | Quercus faginea | Ref. |
Plantae | Fagaceae | Quercus frainetto | Ref. |
Plantae | Fagaceae | Quercus gambelii | Ref. |
Plantae | Fagaceae | Quercus garryana | Ref. |
Plantae | Fagaceae | Quercus ilex | Ref. |
Plantae | Fagaceae | Quercus incana | Ref. |
Plantae | Fagaceae | Quercus ithaburiensis | Ref. |
Plantae | Fagaceae | Quercus laevis | Ref. |
Plantae | Fagaceae | Quercus laurifolia | Ref. |
Plantae | Fagaceae | Quercus libani | Ref. |
Plantae | Fagaceae | Quercus lobata | Ref. |
Plantae | Fagaceae | Quercus macrolepis | Ref. |
Plantae | Fagaceae | Quercus mexicana | Ref. |
Plantae | Fagaceae | Quercus nigra | Ref. |
Plantae | Fagaceae | Quercus petraea | Ref. |
Plantae | Fagaceae | Quercus phellos | Ref. |
Plantae | Fagaceae | Quercus prinus | Ref. |
Plantae | Fagaceae | Quercus pubescens | Ref. |
Plantae | Fagaceae | Quercus pyrenaica | Ref. |
Plantae | Fagaceae | Quercus robur | Ref. |
Plantae | Fagaceae | Quercus rotundifolia | Ref. |
Plantae | Fagaceae | Quercus rubra | Ref. |
Plantae | Fagaceae | Quercus serrata | Ref. |
Plantae | Fagaceae | Quercus suber | Ref. |
Plantae | Fagaceae | Quercus trojana | Ref. |
Plantae | Fagaceae | Quercus velutina | Ref. |
Plantae | Fagaceae | Quercus virginiana | Ref. |
Plantae | Fagaceae | Quercus wislizenii | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hamamelidaceae | Hamamelis virginiana | Ref. |
Plantae | Hamamelidaceae | Liquidambar styraciflua | Ref. |
Plantae | Irvingiaceae | Irvingia gabonensis | Ref. |
Plantae | Juglandaceae | Carya aquatica | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia mellifera | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Persea americana | Ref. |
Plantae | Lauraceae | Persea borbonia | Ref. |
Plantae | Lythraceae | Lagerstroemia indica | Ref. |
Plantae | Magnoliaceae | Liriodendron tulipifera | Ref. |
Plantae | Magnoliaceae | Magnolia grandiflora | Ref. |
Plantae | Malvaceae | Gossypium hirsutum | Ref. |
Plantae | Malvaceae | Grewia flavescens | Ref. |
Plantae | Malvaceae | Tilia americana | Ref. |
Plantae | Moraceae | Ficus carica | Ref. |
Plantae | Moraceae | Ficus fistulosa | Ref. |
Plantae | Moraceae | Ficus glumosa | Ref. |
Plantae | Moraceae | Morus rubra | Ref. |
Plantae | Moraceae | Trilepisium madagascariense | Ref. |
Plantae | Myrtaceae | Callistemon citrinus | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Eucalyptus viminalis | Ref. |
Plantae | Myrtaceae | Eugenia foetida | Ref. |
Plantae | Myrtaceae | Eugenia grandis | Ref. |
Plantae | Myrtaceae | Eugenia xerophytica | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Myrtaceae | Syzygium guineense | Ref. |
Plantae | Nyctaginaceae | Pisonia albida | Ref. |
Plantae | Ochnaceae | Lophira alata | Ref. |
Plantae | Ochnaceae | Lophira lanceolata | Ref. |
Plantae | Ochnaceae | Ochna pulchra | Ref. |
Plantae | Oleaceae | Fraxinus caroliniana | Ref. |
Plantae | Oleaceae | Fraxinus uhdei | Ref. |
Plantae | Oleaceae | Ligustrum lucidum | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Oleaceae | Phillyrea angustifolia | Ref. |
Plantae | Palmae | Elaeis guineensis | Ref. |
Plantae | Palmae | Phoenix dactylifera | Ref. |
Plantae | Palmae | Phoenix reclinata | Ref. |
Plantae | Palmae | Sabal palmetto | Ref. |
Plantae | Palmae | Serenoa repens | Ref. |
Plantae | Palmae | Washingtonia filifera | Ref. |
Plantae | Phyllanthaceae | Securinega virosa | Ref. |
Plantae | Pinaceae | Abies alba | Ref. |
Plantae | Pinaceae | Abies lasiocarpa | Ref. |
Plantae | Pinaceae | Cedrus deodara | Ref. |
Plantae | Pinaceae | Larix decidua | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Picea engelmannii | Ref. |
Plantae | Pinaceae | Picea glauca | Ref. |
Plantae | Pinaceae | Picea mariana | Ref. |
Plantae | Pinaceae | Picea omorika | Ref. |
Plantae | Pinaceae | Picea pungens | Ref. |
Plantae | Pinaceae | Picea rubens | Ref. |
Plantae | Pinaceae | Picea sitchensis | Ref. |
Plantae | Pinaceae | Pinus canariensis | Ref. |
Plantae | Pinaceae | Pinus clausa | Ref. |
Plantae | Pinaceae | Pinus densiflora | Ref. |
Plantae | Pinaceae | Pinus ellotii | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus palustris | Ref. |
Plantae | Pinaceae | Pinus pinaster | Ref. |
Plantae | Pinaceae | Pinus pinea | Ref. |
Plantae | Pinaceae | Pinus ponderosa | Ref. |
Plantae | Pinaceae | Pinus radiata | Ref. |
Plantae | Pinaceae | Pinus sabiniana | Ref. |
Plantae | Pinaceae | Pinus sylvestris | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
Plantae | Pinaceae | Pseudotsuga menziesii ssp. menziessi | Ref. |
Plantae | Pinaceae | Tsuga mertensiana | Ref. |
Plantae | Pittosporaceae | Pittosporum tobira | Ref. |
Plantae | Platanaceae | Platanus hybrida | Ref. |
Plantae | Platanaceae | Platanus occidentalis | Ref. |
Plantae | Platanaceae | Platanus racemosa | Ref. |
Plantae | Poaceae | Agrostis curtissii | Ref. |
Plantae | Poaceae | Arundo donax | Ref. |
Plantae | Poaceae | Avena sativa | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Phragmites mauritianum | Ref. |
Plantae | Poaceae | Secale cereale | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Eriogonum fasciculatum | Ref. |
Plantae | Polygonaceae | Polygonum sachalinense | Ref. |
Plantae | Rhamnaceae | Ceanothus crassifolius | Ref. |
Plantae | Rhamnaceae | Colubrina texensis | Ref. |
Plantae | Rhamnaceae | Krugiodendron ferreum | Ref. |
Plantae | Rhamnaceae | Rhamnus californica | Ref. |
Plantae | Rhamnaceae | Rhamnus crocea | Ref. |
Plantae | Rhamnaceae | Rhamnus lycioides | Ref. |
Plantae | Rhizophoraceae | Rhizophora mangle | Ref. |
Plantae | Rosaceae | Adenostoma fasciculatum | Ref. |
Plantae | Rosaceae | Amelanchier alnifolia | Ref. |
Plantae | Rosaceae | Cercocarpus montanus | Ref. |
Plantae | Rosaceae | Cotoneaster pannosus | Ref. |
Plantae | Rosaceae | Malus domestica | Ref. |
Plantae | Rosaceae | Pyrus kawakamii | Ref. |
Plantae | Rosaceae | Rhaphiolepis indica | Ref. |
Plantae | Rosaceae | Rubus fruticosus | Ref. |
Plantae | Rosaceae | Rubus ursinus | Ref. |
Plantae | Rosaceae | Sorbus scopulina | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Salicaceae | Populus alba | Ref. |
Plantae | Salicaceae | Populus balsamifera | Ref. |
Plantae | Salicaceae | Populus balsamifera ssp. trichocarpa | Ref. |
Plantae | Salicaceae | Populus deltoides | Ref. |
Plantae | Salicaceae | Populus nigra | Ref. |
Plantae | Salicaceae | Populus tremula | Ref. |
Plantae | Salicaceae | Populus tremuloides | Ref. |
Plantae | Salicaceae | Salix alba | Ref. |
Plantae | Salicaceae | Salix atrocineria | Ref. |
Plantae | Salicaceae | Salix babylonica | Ref. |
Plantae | Salicaceae | Salix caroliniana | Ref. |
Plantae | Salicaceae | Salix nigra | Ref. |
Plantae | Salicaceae | Salix phylicifolia | Ref. |
Plantae | Salicaceae | Xylosma congestum | Ref. |
Plantae | Sapindaceae | Acer campestre | Ref. |
Plantae | Sapindaceae | Acer floridanum | Ref. |
Plantae | Sapindaceae | Acer platanoides | Ref. |
Plantae | Sapindaceae | Acer saccharinum | Ref. |
Plantae | Sapindaceae | Aesculus flava | Ref. |
Plantae | Sapindaceae | Cupania anacardioides | Ref. |
Plantae | Thelypteridaceae | Thelypteris decursive-pinnata | Ref. |
Plantae | Thymelaeaceae | Daphne gnidium | Ref. |
Plantae | Ulmaceae | Ulmus americana | Ref. |
Plantae | Ulmaceae | Ulmus parvifolia | Ref. |
Plantae | Verbenaceae | Aloysia gratissima | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
- | - | Berlinia bracteosa | Ref. |
- | - | Berlinia grandifolia | Ref. |
- | - | Chamaespartium tridentatum | Ref. |
- | - | Cupaniopsis anacardiodides | Ref. |
- | - | Dalhousiea africana | Ref. |
- | - | Frangula alnus Miller | Ref. |
- | - | Gilbertiodendron dewevrei | Ref. |
- | - | Isoberlinia doka | Ref. |
- | - | Klainedoxa gabonensis | Ref. |
- | - | Pancovia laurentii | Ref. |
- | - | Parinari cunatellifolia | Ref. |
- | - | Pictetia aculeata | Ref. |
- | - | Reynosa guama | Ref. |
- | - | Sclerocarya birrea | Ref. |
- | - | Tecomaria capensis | Ref. |
- | - | ochna pulchra | Ref. |
|
|
zoom in
Organism | Quercus wislizenii | Reference | Rasmussen,R.A.,Special report of Air Pollut. Res. Section, Washington State University, Pullman, (1978)
Csiky, O.et al., A laboratory screening study of Mediterranean oak species for VOC emissions. Presented at the Biogenic Hydrocarbons Workshop, Charlott |
---|
|