| Name |
Justicidin A |
| Formula |
C22H18O7 |
| Mw |
394.10525293 |
| CAS RN |
25001-57-4 |
| C_ID |
C00000700
, 
|
| InChIKey |
ANFSXHKDCKWWDB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H18O7/c1-24-16-7-12-13(8-17(16)25-2)21(26-3)14-9-27-22(23)20(14)19(12)11-4-5-15-18(6-11)29-10-28-15/h4-8H,9-10H2,1-3H3 |
| SMILES |
c1(c(cc2c(c1)c(c1c(c2c2ccc3c(c2)OCO3)C(=O)OC1)OC)OC)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Justicia ciliata | Ref. |
| Plantae | Acanthaceae | Justicia diffusa var. prostrata | Ref. |
| Plantae | Acanthaceae | Justicia hayatai var.decumbens | Ref. |
| Plantae | Acanthaceae | Justicia hayati | Ref. |
| Plantae | Acanthaceae | Justicia neesii | Ref. |
| Plantae | Acanthaceae | Justicia procumbens  | Ref. |
| Plantae | Acanthaceae | Justicia procumbens L. var. leucantha | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia subelliptica Merr. | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus myrtifolius | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus oligospermus | Ref. |
| Plantae | Rutaceae | Cneoridium dumosum | Ref. |
| Plantae | Rutaceae | Haplophyllum cappadocicum | Ref. |
| Plantae | Rutaceae | Haplophyllum tuberculatum | Ref. |
| - | - | Rostellularia procumbens | Ref. |
| - | - | Usticia procumbens | Ref. |
|
|
zoom in
| Organism | Rostellularia procumbens |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Gonzales, et al., Planta Med, 36, (1979), 200.
Khalid, et al., Ethnopharmacol, 15, (1986), 201.
Munakata, et al., Tetrahedron Lett, (1965), 4167.
Day, et al., Journal of Natural Products, 65, (2002), 379.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985) |
|---|
|
