Name |
Herbacetin |
Formula |
C15H10O7 |
Mw |
302.04265268 |
CAS RN |
527-95-7 |
C_ID |
C00001048
,
|
InChIKey |
ZDOTZEDNGNPOEW-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O7/c16-7-3-1-6(2-4-7)14-13(21)12(20)10-8(17)5-9(18)11(19)15(10)22-14/h1-5,16-19,21H |
SMILES |
c1(cc(c2c(c1O)oc(c(c2=O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Eupatorium gracile | Ref. |
Plantae | Asteraceae | Ozothamnus hookeri | Ref. |
Plantae | Chenopodiaceae | Chenopodium murale | Ref. |
Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
Plantae | Crassulaceae | Rhodiola rosea | Ref. |
Plantae | Crassulaceae | Sedum album | Ref. |
Plantae | Crassulaceae | Sinocrassula indica | Ref. |
Plantae | Ephedraceae | Ephedra alata | Ref. |
Plantae | Ephedraceae | Ephedra aphylla | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Equisetaceae | Equisetum fluviatile | Ref. |
Plantae | Malvaceae | Gossypium herbaceum | Ref. |
Plantae | Papaveraceae | Meconopsis paniculata | Ref. |
Plantae | Phrymaceae | Mimulus luteus | Ref. |
Plantae | Primulaceae | Primula alpicola | Ref. |
Plantae | Rosaceae | Crataegus curvisepala | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Zygophyllaceae | Fagonia alba | Ref. |
Plantae | Zygophyllaceae | Fagonia taeckholmiana | Ref. |
|
|
zoom in
Organism | Mimulus luteus | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Neelakantam,Proc.Indian Acad.Sco.,Sect.A.,5,(1937),357
Harborne,Phytochem.,8,(1969),177 |
---|
|