| Name |
Thujopsene
Sesquichamene
Widdrene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
470-40-6 |
| C_ID |
C00003194
, 
|
| InChIKey |
WXQGPFZDVCRBME-NIPBAURFNA-N |
| InChICode |
InChI=1S/C15H24/c1-11-6-9-14(4)8-5-7-13(2,3)15(14)10-12(11)15/h6,12H,5,7-10H2,1-4H3/t12-,14-,15-/m0/s1 |
| SMILES |
C1CC([C@@]23[C@@](C1)(CC=C([C@@H]2C3)C)C)(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Asteraceae | Petasites albus | Ref. |
| Plantae | Asteraceae | Petasites hybridus | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cupressaceae | Callitris sulcata | Ref. |
| Plantae | Cupressaceae | Juniperus recurva Buch. | Ref. |
| Plantae | Cupressaceae | Neocallitropsis pancheri | Ref. |
| Plantae | Cupressaceae | Thujopsis dolabrata | Ref. |
| Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
| Plantae | Jubulaceae | Frullania falciloba | Ref. |
| Plantae | Lejeuneaceae | Trocholejeunea sandvicensis | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis | Ref. |
| Plantae | Zingiberaceae | Curcuma longa | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
| - | - | Microcystis aeruginosa | Ref. |
|
|
zoom in
| Organism | Schisandra chinensis |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|
