Name |
Thujopsene Sesquichamene Widdrene |
Formula |
C15H24 |
Mw |
204.18780077 |
CAS RN |
470-40-6 |
C_ID |
C00003194
, 
|
InChIKey |
WXQGPFZDVCRBME-NIPBAURFNA-N |
InChICode |
InChI=1S/C15H24/c1-11-6-9-14(4)8-5-7-13(2,3)15(14)10-12(11)15/h6,12H,5,7-10H2,1-4H3/t12-,14-,15-/m0/s1 |
SMILES |
C1CC([C@@]23[C@@](C1)(CC=C([C@@H]2C3)C)C)(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Cananga odorata  | Ref. |
Plantae | Asteraceae | Petasites albus  | Ref. |
Plantae | Asteraceae | Petasites hybridus  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cupressaceae | Callitris sulcata | Ref. |
Plantae | Cupressaceae | Juniperus recurva Buch.  | Ref. |
Plantae | Cupressaceae | Neocallitropsis pancheri | Ref. |
Plantae | Cupressaceae | Thujopsis dolabrata | Ref. |
Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
Plantae | Jubulaceae | Frullania falciloba | Ref. |
Plantae | Lejeuneaceae | Trocholejeunea sandvicensis | Ref. |
Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
Plantae | Zingiberaceae | Curcuma longa  | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
- | - | Microcystis aeruginosa | Ref. |
|
|
zoom in
Organism | Schisandra chinensis | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
---|
|