Name |
5-Hydroxy-6,7,3',4'-tetramethoxyflavone 6-Hydroxyluteolin 6,7,3',4'-tetramethyl ether 2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one |
Formula |
C19H18O7 |
Mw |
358.10525293 |
CAS RN |
21763-80-4 |
C_ID |
C00003898
,
|
InChIKey |
QEWSAPKRFOFQIU-UHFFFAOYSA-N |
InChICode |
InChI=1S/C19H18O7/c1-22-12-6-5-10(7-14(12)23-2)13-8-11(20)17-15(26-13)9-16(24-3)19(25-4)18(17)21/h5-9,21H,1-4H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)OC)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea conferta | Ref. |
Plantae | Asteraceae | Achillea santolina | Ref. |
Plantae | Asteraceae | Artemisia argyi | Ref. |
Plantae | Asteraceae | Artemisia austriaca | Ref. |
Plantae | Asteraceae | Artemisia giraldii | Ref. |
Plantae | Asteraceae | Artemisia mongolica | Ref. |
Plantae | Asteraceae | Artemisia sieversiana | Ref. |
Plantae | Asteraceae | Artemisia verlotiorum | Ref. |
Plantae | Asteraceae | Brickellia scoparia | Ref. |
Plantae | Asteraceae | Centaurea granata | Ref. |
Plantae | Asteraceae | Centaurea macrocephala | Ref. |
Plantae | Asteraceae | Chromolaena arnottiana | Ref. |
Plantae | Asteraceae | Eupatorium altissimum | Ref. |
Plantae | Asteraceae | Eupatorium microphyllum | Ref. |
Plantae | Asteraceae | Lagophylla glandulosa | Ref. |
Plantae | Asteraceae | Parthenium incanum | Ref. |
Plantae | Asteraceae | Tanacetum santolinioides | Ref. |
Plantae | Labiatae | Cunila angustifolia | Ref. |
Plantae | Labiatae | Cunila incana | Ref. |
Plantae | Labiatae | Isodon leucophyllus | Ref. |
Plantae | Labiatae | Mentha longifolia | Ref. |
Plantae | Labiatae | Mentha piperita L.var.kubamskaya | Ref. |
Plantae | Labiatae | Mentha pulegium | Ref. |
Plantae | Labiatae | Micromeria albanica | Ref. |
Plantae | Labiatae | Ocimum americanum var. americanum | Ref. |
Plantae | Labiatae | Orthosiphon aristatus | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Salvia dominica | Ref. |
Plantae | Labiatae | Salvia macrosiphon | Ref. |
Plantae | Labiatae | Salvia mirzayani | Ref. |
Plantae | Labiatae | Salvia syriaca | Ref. |
Plantae | Labiatae | Salvia tomentosa | Ref. |
Plantae | Labiatae | Sideritis angustifolia | Ref. |
Plantae | Labiatae | Sideritis soluta | Ref. |
Plantae | Labiatae | Teucrium alyssifolium | Ref. |
Plantae | Labiatae | Teucrium botrys | Ref. |
Plantae | Labiatae | Teucrium pseudochamaepitys | Ref. |
Plantae | Labiatae | Ziziphora hispanica | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus tangerina | Ref. |
Plantae | Rutaceae | Merrillia caloxylon | Ref. |
Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
|
|
zoom in
Organism | Eupatorium microphyllum | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Fraser,Phytochem.,13,(1974),1561
Tomas-Lorente,Phytochem.,28,(1989),2141 |
---|
|