Name |
5,7,3',4'-Tetrahydroxyflavone 4'-beta-D-glucopyranoside Luteolin 4'-O-beta-D-glucopyranoside Luteolin 4'-glucoside Juncein Luteolin-4'-O-glucoside |
Formula |
C21H20O11 |
Mw |
448.10056148 |
CAS RN |
6920-38-3 |
C_ID |
C00004276
,
|
InChIKey |
UHNXUSWGOJMEFO-CFBYCNAUNA-N |
InChICode |
InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)31-13-2-1-8(3-10(13)24)14-6-12(26)17-11(25)4-9(23)5-15(17)30-14/h1-6,16,18-25,27-29H,7H2/t16-,18-,19-,20+,21-/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O[C@H]1[C@H]([C@@H]([C@@H]([C@H](O1)CO)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apocynaceae | Trachelospermum jasminoides | Ref. |
Plantae | Asteraceae | Gnaphalium affine | Ref. |
Plantae | Asteraceae | Helichrysum graveolen | Ref. |
Plantae | Asteraceae | Saussurea medusa | Ref. |
Plantae | Fabaceae | Bauhinia tarapotensis | Ref. |
Plantae | Fabaceae | Genista corsica | Ref. |
Plantae | Fabaceae | Kummerowia striata | Ref. |
Plantae | Fabaceae | Lathyrus pratensis | Ref. |
Plantae | Fabaceae | Lupinus polyphyllus | Ref. |
Plantae | Fabaceae | Spartium junceum | Ref. |
Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
Plantae | Solanaceae | Physalis alkekengi var. franchetii | Ref. |
Plantae | Uvulariaceae | Disporum cantoniense | Ref. |
|
|
zoom in
Organism | Disporum cantoniense | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Spada,Gazz,Chim.Ital.,88,(1958),204
Williams,Phytochem.,34,(1993),197 |
---|
|