Name |
5-Hydroxy-3,6,7,4'-tetramethoxyflavone 6-Hydroxykaempferol-3,6,7,4'-tetramethyl ether Penduletin 4'-methyl ether 5-Hydroxy-3,6,7-trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C19H18O7 |
Mw |
358.10525293 |
CAS RN |
14787-34-9 |
C_ID |
C00004607
, 
|
InChIKey |
ADNCDMHZHONBRR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)17-19(25-4)16(21)14-12(26-17)9-13(23-2)18(24-3)15(14)20/h5-9,20H,1-4H3 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)OC)c1ccc(cc1)OC)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea millefolium L.  | Ref. |
Plantae | Asteraceae | Achillea sibirica subsp.mongolica | Ref. |
Plantae | Asteraceae | Ageratina espinosara | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Blumea malcomii | Ref. |
Plantae | Asteraceae | Brickellia eupatorioides | Ref. |
Plantae | Asteraceae | Grindelia glutinosa | Ref. |
Plantae | Asteraceae | Parthenium incanum | Ref. |
Plantae | Bromeliaceae | Tillandsia utriculata | Ref. |
Plantae | Crassulaceae | Aeonium spp. | Ref. |
Plantae | Labiatae | Sideritis nutans | Ref. |
Plantae | Labiatae | Vitex agnus-castus  | Ref. |
Plantae | Meliaceae | Aglaia edulis  | Ref. |
Plantae | Rutaceae | Drummondita hassellii | Ref. |
Plantae | Sapindaceae | Dodonaea lobulata | Ref. |
Plantae | Sapindaceae | Dodonaea viscosa  | Ref. |
Plantae | Verbenaceae | Duranta repens | Ref. |
|
|
zoom in
Organism | Drummondita hassellii | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Dawson,Aust.J.Chem.,19,(1966),2133
Markham,Phytochem.,28,(1989),243 |
---|
|