Name |
Petunin Petunidin 3,5-di-O-beta-D-glucoside |
Formula |
C28H33O17 |
Mw |
641.17177463 |
CAS RN |
25846-73-5 |
C_ID |
C00006728
,
|
InChIKey |
KLRABYJGMPNMSA-LOHFLRHRNA-O |
InChICode |
InChI=1S/C28H32O17/c1-40-15-3-9(2-12(32)19(15)33)26-16(43-28-25(39)23(37)21(35)18(8-30)45-28)6-11-13(41-26)4-10(31)5-14(11)42-27-24(38)22(36)20(34)17(7-29)44-27/h2-6,17-18,20-25,27-30,34-39H,7-8H2,1H3,(H2-,31,32,33)/p+1/t17-,18-,20-,21-,22+,23+,24-,25-,27-,28-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1cc(c(c(c1)OC)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Elaeocarpaceae | Aristotelia chilensis | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Vicia spp. | Ref. |
Plantae | Geraniaceae | Pelargonium dolomiticum | Ref. |
Plantae | Iridaceae | Crocus antalyensis | Ref. |
Plantae | Iridaceae | Crocus sieberi | Ref. |
Plantae | Iridaceae | Gladiolus spp. | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Myrsinaceae | Cyclamen persicum | Ref. |
Plantae | Myrtaceae | Metrosideros spp. | Ref. |
Plantae | Onagraceae | Fuchsia spp. | Ref. |
Plantae | Passifloraceae | Passiflora quadrangularis | Ref. |
Plantae | Rosaceae | Rosa spp. | Ref. |
Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
Plantae | Solanaceae | Petunia x hybrida | Ref. |
Plantae | Vitaceae | Vitis rotundifolia | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zingiberaceae | Renealmia regmelliana | Ref. |
|
|
zoom in
Organism | Passiflora quadrangularis | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann.412,(1917),217 |
---|
|