Name |
Dihydrochelerythrine 12,13-Dihydrochelerythrine |
Formula |
C21H19NO4 |
Mw |
349.1314081 |
CAS RN |
6880-91-7 |
C_ID |
C00024641
, 
|
InChIKey |
ALZAZMCIBRHMFF-UHFFFAOYSA-N |
InChICode |
InChI=1S/C21H19NO4/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22/h4-9H,10-11H2,1-3H3 |
SMILES |
c12c(cc3c(c1)ccc1c3N(Cc3c1ccc(c3OC)OC)C)OCO2 |
Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia lucida  | Ref. |
Plantae | Fumariaceae | Corydalis ledebouriana | Ref. |
Plantae | Meliaceae | Xylocarpus granatum  | Ref. |
Plantae | Papaveraceae | Bocconia integrifolia  | Ref. |
Plantae | Papaveraceae | Eschscholtzia californica Cham | Ref. |
Plantae | Papaveraceae | Glaucium bois | Ref. |
Plantae | Papaveraceae | Glaucium elegans | Ref. |
Plantae | Papaveraceae | Glaucium flavum Cr.var.vestitum  | Ref. |
Plantae | Rutaceae | Fagara angolensis | Ref. |
Plantae | Rutaceae | Fagara chalybea Engl. | Ref. |
Plantae | Rutaceae | Fagara holstii | Ref. |
Plantae | Rutaceae | Toddalia asiatica Lamk.  | Ref. |
Plantae | Rutaceae | Zanthoxylum coriaceum | Ref. |
Plantae | Rutaceae | Zanthoxylum spinosum Swingle | Ref. |
Plantae | Rutaceae | Zanthoxylum tessmannii | Ref. |
|
|
zoom in
Organism | Zanthoxylum spinosum Swingle | Reference | Gray,The Chemistry and Biology of Isoquinoline Alkaloids.London,(1984),20 |
---|
|