Name |
beta-Myrcene Myrcene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
123-35-3 |
C_ID |
C00000853
, 
|
InChIKey |
UAHWPYUMFXYFJY-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H3 |
SMILES |
C(CC=C(C)C)C(=C)C=C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Anacardiaceae | Anacardium occidentale  | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Annonaceae | Cananga odorata  | Ref. |
Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
Plantae | Annonaceae | Monodora myristica  | Ref. |
Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
Plantae | Annonaceae | Xylopia frutescens  | Ref. |
Plantae | Annonaceae | Xylopia parviflora  | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Apiaceae | Ferula iliensis | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
Plantae | Aristolochiaceae | Aristolochia trilobata  | Ref. |
Plantae | Aristolochiaceae | Asarum heteropoides var.mandshuricum | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
Plantae | Asteraceae | Ambrosia artemisiifolia | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Artemisia capillaris  | Ref. |
Plantae | Asteraceae | Artemisia scoparia  | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Petasites albus  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Porophyllum ruderale  | Ref. |
Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
Plantae | Asteraceae | Saussurea lappa  | Ref. |
Plantae | Asteraceae | Senecio vulgaris  | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Canellaceae | Pleodendron costaricense | Ref. |
Plantae | Cannabaceae | Cannabis inflorescences | Ref. |
Plantae | Cannabaceae | Humulus lupulus  | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Hesperis matronalis  | Ref. |
Plantae | Cupressaceae | Calocedrus macrolepis var.formosana | Ref. |
Plantae | Cupressaceae | Chamaecyparis obtusa var.formosana | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
Plantae | Ephedraceae | Ephedra sinica  | Ref. |
Plantae | Ericaceae | Ledum palustre L.  | Ref. |
Plantae | Fabaceae | Medicago sativa  | Ref. |
Plantae | Fagaceae | Quercus coccifera  | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
Plantae | Geraniaceae | Pelargonium quercifolium  | Ref. |
Plantae | Geraniaceae | Pelargonium tomentosum  | Ref. |
Plantae | Jubulaceae | Frullania monocera | Ref. |
Plantae | Labiatae | Lavandula angustifolia  | Ref. |
Plantae | Labiatae | Lavandula bipinnata  | Ref. |
Plantae | Labiatae | Lavandula canarien-sis | Ref. |
Plantae | Labiatae | Lavandula dentata  | Ref. |
Plantae | Labiatae | Lavandula gibsoni | Ref. |
Plantae | Labiatae | Lavandula multifida  | Ref. |
Plantae | Labiatae | Lavandula stoechas  | Ref. |
Plantae | Labiatae | Melissa officinalis  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Salvia officinalis  | Ref. |
Plantae | Labiatae | Thymus X-porlock | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Labiatae | Thymus eriocalyx | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Laurus nobilis  | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus gunnii  | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Myrtaceae | Pimenta acris | Ref. |
Plantae | Oleaceae | Forsythia suspensa  | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
Plantae | Pinaceae | Abies grandis | Ref. |
Plantae | Pinaceae | Cedrus libani  | Ref. |
Plantae | Pinaceae | Picea ajanensis | Ref. |
Plantae | Pinaceae | Picea glehnii L. | Ref. |
Plantae | Pinaceae | Picea koraiensis | Ref. |
Plantae | Pinaceae | Pinus banksiana  | Ref. |
Plantae | Pinaceae | Pinus cembra  | Ref. |
Plantae | Pinaceae | Pinus contorta var. latifolia  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Piperaceae | Piper arboreum  | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Poaceae | Phyllostachys abies | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rubiaceae | Coffea arabica  | Ref. |
Plantae | Rutaceae | Boenninghausenia albiflora  | Ref. |
Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
Plantae | Rutaceae | Citrus aurantium  | Ref. |
Plantae | Rutaceae | Citrus grandis  | Ref. |
Plantae | Rutaceae | Citrus hystrix  | Ref. |
Plantae | Rutaceae | Citrus latifolia  | Ref. |
Plantae | Rutaceae | Citrus limettioides | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus medica  | Ref. |
Plantae | Rutaceae | Citrus paradise x Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Citrus paradisi  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Citrus sinki x Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Citrus unshiu Marc.  | Ref. |
Plantae | Rutaceae | Clausena anisata  | Ref. |
Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
Plantae | Saururaceae | Houttuynia cordata  | Ref. |
Plantae | Saururaceae | Houttuynia cordata Thunb.  | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
Plantae | Solanaceae | Nicotiana alata | Ref. |
Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
Plantae | Solanaceae | Nicotiana mutabilis | Ref. |
Plantae | Solanaceae | Solanum peruvianum | Ref. |
Plantae | Verbenaceae | Lippia chevalieri | Ref. |
Plantae | Verbenaceae | Lippia multiflora  | Ref. |
Plantae | Zingiberaceae | Aframomum melegueta  | Ref. |
Plantae | Zingiberaceae | Amomum medium | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza  | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L.  | Ref. |
- | - | Lavandin abrialis | Ref. |
- | - | Proteaceae | Ref. |
|
|
zoom in
Organism | Notopterygium forbesii | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Suga, et al., Phytochemistry, 14, (1975), 308.
KUO, et al., Chem Pharm Bull, 52, (2004), 764.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985) |
---|
|