| Name |
Coumestrol
Cumestrol
3,9-Dihydroxycoumestan
Coumesterol |
| Formula |
C15H8O5 |
| Mw |
268.03717337 |
| CAS RN |
479-13-0 |
| C_ID |
C00002514
, 
|
| InChIKey |
ZZIALNLLNHEQPJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H8O5/c16-7-1-3-9-11(5-7)19-14-10-4-2-8(17)6-12(10)20-15(18)13(9)14/h1-6,16-17H |
| SMILES |
c1(ccc2c(c1)oc(=O)c1c2oc2c1ccc(c2)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Brassica oleracea | Ref. |
| Plantae | Fabaceae | Bituminaria morisiana | Ref. |
| Plantae | Fabaceae | Cullen corylifolium | Ref. |
| Plantae | Fabaceae | Dolichos biflorus | Ref. |
| Plantae | Fabaceae | Glycine canescens | Ref. |
| Plantae | Fabaceae | Glycine clandestina | Ref. |
| Plantae | Fabaceae | Glycine falcata | Ref. |
| Plantae | Fabaceae | Glycine latifolia | Ref. |
| Plantae | Fabaceae | Glycine max | Ref. |
| Plantae | Fabaceae | Glycine tabacina | Ref. |
| Plantae | Fabaceae | Glycine tomentella | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago sativa | Ref. |
| Plantae | Fabaceae | Medicago spp. | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus alba | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
| Plantae | Fabaceae | Pisum sativum | Ref. |
| Plantae | Fabaceae | Pueraria lobata | Ref. |
| Plantae | Fabaceae | Pueraria mirifica | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Trifolium fragiferum | Ref. |
| Plantae | Fabaceae | Trifolium pratense | Ref. |
| Plantae | Fabaceae | Trifolium repens | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum | Ref. |
| Plantae | Fabaceae | Vigna radiata | Ref. |
| Plantae | Fabaceae | Vigna unguiculata | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
|
|
zoom in
| Organism | Medicago sativa |
|---|
| Reference | Cottiglia, et al., Planta Med, 71, (2005), 254.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|
