| Name |
(-)-epsilon-Viniferin
epsilon-Viniferin |
| Formula |
C28H22O6 |
| Mw |
454.14163844 |
| CAS RN |
62218-08-0 |
| C_ID |
C00002905
, 
|
| InChIKey |
FQWLMRXWKZGLFI-XONQPWEHNA-N |
| InChICode |
InChI=1S/C28H22O6/c29-20-7-2-16(3-8-20)1-4-18-11-24(33)15-25-26(18)27(19-12-22(31)14-23(32)13-19)28(34-25)17-5-9-21(30)10-6-17/h1-15,27-33H/b4-1+/t27-,28+/m1/s1 |
| SMILES |
c1cc(ccc1/C=C/c1cc(cc2c1[C@H]([C@@H](O2)c1ccc(cc1)O)c1cc(cc(c1)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cyperaceae | Carex kobomugi | Ref. |
| Plantae | Cyperaceae | Scirpus maritimus  | Ref. |
| Plantae | Dipterocarpaceae | Hopea parviflora | Ref. |
| Plantae | Dipterocarpaceae | Hopea utilis | Ref. |
| Plantae | Dipterocarpaceae | Shorea disticha | Ref. |
| Plantae | Dipterocarpaceae | Vatica rassak | Ref. |
| Plantae | Fabaceae | Sophora davidii | Ref. |
| Plantae | Gnetaceae | Gnetum gnemon | Ref. |
| Plantae | Gnetaceae | Gnetum hainanense | Ref. |
| Plantae | Gnetaceae | Gnetum klossii | Ref. |
| Plantae | Gnetaceae | Gnetum latifolium Blume | Ref. |
| Plantae | Gnetaceae | Gnetum parvifolium | Ref. |
| Plantae | Vitaceae | Parthenocissus tricuspidata | Ref. |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis rassak | Ref. |
| Plantae | Vitaceae | Vitis riparia | Ref. |
| Plantae | Vitaceae | Vitis rupestris | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
| Organism | Vitis rassak |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Li, et al., APS, 37, (2002), 69.
Li, et al., APS, 36, (2001), 944.
Tanaka, et al., Phytochemistry, 54, (2000), 63.
ILIYA, et al., Chem Pharm Bull, 51, (2003), 85 |
|---|
|
