Name |
ladanetin Sorbifolin |
Formula |
C16H12O6 |
Mw |
300.06338812 |
CAS RN |
23130-22-5 |
C_ID |
C00003835
,
|
InChIKey |
UWARRXZVZDFPQU-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O6/c1-21-13-7-12-14(16(20)15(13)19)10(18)6-11(22-12)8-2-4-9(17)5-3-8/h2-7,17,19-20H,1H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ambrosia ambrosioides | Ref. |
Plantae | Asteraceae | Anvillea garcinii | Ref. |
Plantae | Asteraceae | Onopordon sibthorpianum | Ref. |
Plantae | Asteraceae | Pleocarphus revolutus | Ref. |
Plantae | Bignoniaceae | Adenocalymma alliaceum | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia andamanica | Ref. |
Plantae | Fabaceae | Pterogyne nitens | Ref. |
Plantae | Hydrocharitaceae | Halophila johnsonii | Ref. |
Plantae | Labiatae | Mentha piperita | Ref. |
Plantae | Labiatae | Mentha pulegium | Ref. |
Plantae | Labiatae | Mentha x piperita | Ref. |
Plantae | Labiatae | Thymus herba-barona | Ref. |
Plantae | Plantaginaceae | Scoparia dulcis | Ref. |
Plantae | Rosaceae | Sorbaria sorbifolia | Ref. |
Plantae | Rosaceae | Sorbaria stellipila | Ref. |
Plantae | Rutaceae | Spathelia glabrescens | Ref. |
Plantae | Rutaceae | Spathelia sorbifolia | Ref. |
- | - | Sanbaria stellipila | Ref. |
|
|
zoom in
Organism | Sorbaria stellipila | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Arisawa,Chem.Pharm.Bull.,18,(1970),916
Silva,Phytochem.,16,(1977)379 |
---|
|