| Name |
Quercetagetin |
| Formula |
C15H10O8 |
| Mw |
318.0375673 |
| CAS RN |
90-18-6 |
| C_ID |
C00004677
, 
|
| InChIKey |
ZVOLCUVKHLEPEV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)15-14(22)13(21)10-9(23-15)4-8(18)11(19)12(10)20/h1-4,16-20,22H |
| SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anthemis spp. | Ref. |
| Plantae | Asteraceae | Chrysanthemum spp. | Ref. |
| Plantae | Asteraceae | Eupatorium gracile | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Leucanthemum atratum | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Rudbeckia hirta | Ref. |
| Plantae | Asteraceae | Senecio oryzetorum | Ref. |
| Plantae | Asteraceae | Tagetes erecta | Ref. |
| Plantae | Asteraceae | Tagetes patula | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon spp. | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus polyanthus | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus ramosus | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus robustus | Ref. |
| Plantae | Fabaceae | Acacia catechu | Ref. |
| Plantae | Fabaceae | Leucaena glauca | Ref. |
|
|
zoom in
| Organism | Acacia catechu |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
