Name |
Lauric acid Docosanoic acid n-Dodecanoic acid Dodecanoic acid |
Formula |
C12H24O2 |
Mw |
200.17763001 |
CAS RN |
143-07-7 |
C_ID |
C00001221
,
|
InChIKey |
POULHZVOKOAJMA-UHFFFAOYSA-N |
InChICode |
InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) |
SMILES |
C(=O)(O)CCCCCCCCCCC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
-- | Rhodomelaceae | Acantophora spicifera | Ref. |
Animalia | Hominidae | Homo sapiens (Skin) | Ref. |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Asphodelaceae | Aloe vera var.chinensis | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Petasites hybridus | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
Plantae | Cucurbitaceae | Trichosanthes rosthornii | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Euphorbiaceae | Croton tiglium | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lauraceae | Neolitsea aciculata | Ref. |
Plantae | Lauraceae | Neolitsea sericea | Ref. |
Plantae | Lythraceae | Cuphea carthagenensis | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Palmae | Areca catechu | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Palmae | Elaeis guineensis | Ref. |
Plantae | Pinaceae | Cedrus libani | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Ranunculaceae | Nigella sativa L | Ref. |
Plantae | Rubiaceae | Rubia wallichiana DECNE | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Ulmaceae | Holoptelea integrifolia | Ref. |
Plantae | Verbenaceae | Lantana camara | Ref. |
- | - | Poria cocos | Ref. |
|
|
zoom in
Organism | Trichosanthes rosthornii | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
---|
|