Name |
3,7,4'-Tri-O-methylkaempferol Kaempferol 3,7,4'-trimethyl ether 5-Hydroxy-3,7,4'-trimethoxyflavone 5-Hydroxy-3,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C18H16O6 |
Mw |
328.09468824 |
CAS RN |
15486-34-7 |
C_ID |
C00004573
,
|
InChIKey |
WSQWAMGRHJQANC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)17-18(23-3)16(20)15-13(19)8-12(22-2)9-14(15)24-17/h4-9,19H,1-3H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(cc1)OC)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia campestris | Ref. |
Plantae | Asteraceae | Artemisia rupestris | Ref. |
Plantae | Asteraceae | Baccharis pilularis | Ref. |
Plantae | Asteraceae | Grindelia nana | Ref. |
Plantae | Asteraceae | Grindelia tenella | Ref. |
Plantae | Asteraceae | Haplopappus hirtellus | Ref. |
Plantae | Asteraceae | Haplopappus sonorensis | Ref. |
Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
Plantae | Asteraceae | Senecio viscosus | Ref. |
Plantae | Asteraceae | Stevia subpubescens | Ref. |
Plantae | Asteraceae | Xanthocephalum gymnospermoides | Ref. |
Plantae | Betulaceae | Betula nigra | Ref. |
Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
Plantae | Calceolariaceae | Calceolaria chelidonioides | Ref. |
Plantae | Capparaceae | Cleome spinosa | Ref. |
Plantae | Cistaceae | Cistus spp. | Ref. |
Plantae | Crassulaceae | Aeonium goochiae | Ref. |
Plantae | Crassulaceae | Aeonium lindleyi | Ref. |
Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
Plantae | Labiatae | Dorystoechas hastata | Ref. |
Plantae | Labiatae | Sideritis kuegleriana | Ref. |
Plantae | Labiatae | Sideritis lotsyi | Ref. |
Plantae | Lauraceae | Aniba spp. | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus cunninghamii | Ref. |
Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
Plantae | Piperaceae | Piper philippinum | Ref. |
Plantae | Plantaginaceae | Digitalis viridiflora | Ref. |
Plantae | Pteridaceae | Cheilanthes farinosa | Ref. |
Plantae | Pteridaceae | Cheilanthes grisea | Ref. |
Plantae | Sapindaceae | Dodonaea viscosa | Ref. |
Plantae | Solanaceae | Solanum pubescens | Ref. |
Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
Plantae | Zingiberaceae | Alpinia flabellata | Ref. |
Plantae | Zingiberaceae | Amomum koenigii | Ref. |
Plantae | Zingiberaceae | Hedychium coronarium | Ref. |
Plantae | Zingiberaceae | Kaempferia parviflora | Ref. |
- | - | Currania robertiana | Ref. |
- | - | Reneilmia cincinnata | Ref. |
- | - | Sparuna apiosyce | Ref. |
|
|
zoom in
Organism | Cistus spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Erdtman,Tetrahedron (Suppl.7),8,(1966),71 |
---|
|