Name |
Rhamnazin 3,4',5-Trihydroxy-3',7-dimethoxyflavone 7,3'-Di-O-methylquercetin 3,5-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
Formula |
C17H14O7 |
Mw |
330.0739528 |
CAS RN |
552-54-5 |
C_ID |
C00004642
, 
|
InChIKey |
MYMGKIQXYXSRIJ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)OC)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Artemisia campestris  | Ref. |
Plantae | Asteraceae | Grindelia nana | Ref. |
Plantae | Asteraceae | Heterotheca villosa | Ref. |
Plantae | Asteraceae | Madia elegans | Ref. |
Plantae | Asteraceae | Stevia subpubescens | Ref. |
Plantae | Asteraceae | Wedelia biflora  | Ref. |
Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
Plantae | Capparaceae | Capparis tweediana  | Ref. |
Plantae | Cistaceae | Cistus spp. | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
Plantae | Crassulaceae | Aeonium spp. | Ref. |
Plantae | Cunoniaceae | Eucryphia jinksii | Ref. |
Plantae | Escalloniaceae | Escallonia pulverulenta | Ref. |
Plantae | Geraniaceae | Geranium macrorrhizum  | Ref. |
Plantae | Labiatae | Orthosiphon spicatus | Ref. |
Plantae | Malvaceae | Kitaibela vitifolia | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus cunninghamii | Ref. |
Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
Plantae | Passifloraceae | Passiflora palmeri | Ref. |
Plantae | Polygonaceae | Polygonum polystachyum | Ref. |
Plantae | Polygonaceae | Polygonum punctatum  | Ref. |
Plantae | Pteridaceae | Notholaena nivea | Ref. |
Plantae | Rhamnaceae | Rhamnus cathartica  | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Santalaceae | Viscum cruciatum  | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
Plantae | Solanaceae | Salpiglossis sinuata | Ref. |
Plantae | Zygophyllaceae | Larrea cuneifolia  | Ref. |
- | - | Siegesbeckia jorullensis | Ref. |
|
|
zoom in
Organism | Geranium macrorrhizum | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Perkin,J.Chem.Soc.,67,(1895),500
Perkin,J.Chem.Soc.,81,(1902),469 |
---|
|