Name |
Casticin 3,6,7,4'-Tetra-O-methyl-5,3'-dihydroxyflavone Quercetagetin 3,6,7,4'-tetramethyl ether Vitexicarpin 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
Formula |
C19H18O8 |
Mw |
374.10016755 |
CAS RN |
479-91-4 |
C_ID |
C00004705
,
|
InChIKey |
PJQLSMYMOKWUJG-UHFFFAOYSA-N |
InChICode |
InChI=1S/C19H18O8/c1-23-11-6-5-9(7-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)O)OC)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea clavennae | Ref. |
Plantae | Asteraceae | Achillea millefolium L. | Ref. |
Plantae | Asteraceae | Achillea sibirica subsp.mongolica | Ref. |
Plantae | Asteraceae | Artemisia abrotanum | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia scoparia. | Ref. |
Plantae | Asteraceae | Brickellia spp. | Ref. |
Plantae | Asteraceae | Lagophylla glandulosa | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Parthenium incanum | Ref. |
Plantae | Asteraceae | Parthenium spp. | Ref. |
Plantae | Asteraceae | Tanacetum polycephalum | Ref. |
Plantae | Bromeliaceae | Bromelia pinguin | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
Plantae | Labiatae | Callicarpa pilosissima | Ref. |
Plantae | Labiatae | Vitex agnus-castus | Ref. |
Plantae | Labiatae | Vitex negundo | Ref. |
Plantae | Labiatae | Vitex rotundifolia | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Plantaginaceae | Digitalis thapsii | Ref. |
Plantae | Saxifragaceae | Chrysosplenium japonicum | Ref. |
Plantae | Saxifragaceae | Chrysosplenium tosaense | Ref. |
|
|
zoom in
Organism | Vitex agnus-castus | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Belic,J.Chem.Soc.,(1961),2523 |
---|
|