Name |
Sulfuretin Sulphuretin 6,3',4'-Trihydroxyaurone |
Formula |
C15H10O5 |
Mw |
270.05282343 |
CAS RN |
120-05-8 |
C_ID |
C00008026
,
|
InChIKey |
RGNXWPVNPFAADO-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O5/c16-9-2-3-10-13(7-9)20-14(15(10)19)6-8-1-4-11(17)12(18)5-8/h1-7,16-18H/b14-6+ |
SMILES |
c12c(cc(cc1)O)O/C(=C/c1ccc(c(c1)O)O)/C2=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Actinocheita filicina | Ref. |
Plantae | Anacardiaceae | Amphipterygium adstringens | Ref. |
Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
Plantae | Anacardiaceae | Cotinus spp. | Ref. |
Plantae | Anacardiaceae | Malosma laurina | Ref. |
Plantae | Anacardiaceae | Metopium spp. | Ref. |
Plantae | Anacardiaceae | Rhus javanica | Ref. |
Plantae | Anacardiaceae | Rhus verniciflua | Ref. |
Plantae | Anacardiaceae | Toxicodendron spp. | Ref. |
Plantae | Asteraceae | Baeria chrysostoma | Ref. |
Plantae | Asteraceae | Bidens spp. | Ref. |
Plantae | Asteraceae | Cosmos sulphureus | Ref. |
Plantae | Asteraceae | Dahlia variabilis | Ref. |
Plantae | Asteraceae | Viguiera multiflora | Ref. |
Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
Plantae | Cyperaceae | Cyperus capitatus | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dipteryx odorata | Ref. |
Plantae | Passifloraceae | Passiflora sexflora | Ref. |
- | - | Lnema globularia | Ref. |
|
|
zoom in
Organism | Cyperus capitatus | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
King,Proc.Chem.Soc.,(1957),341
Young,Am.J.Bot.,66,(1979),502 |
---|
|