| Name |
Martynoside |
| Formula |
C31H40O15 |
| Mw |
652.23672061 |
| CAS RN |
67884-12-2 |
| C_ID |
C00034597
, 
|
| InChIKey |
WLWAYPFRKDSFCL-HCRRKUBANA-N |
| InChICode |
InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-20(40-2)19(34)12-17)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)21(13-16)41-3/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3/b9-6+/t15-,22+,24-,25+,26+,27+,28+,29+,30+,31-/m0/s1 |
| SMILES |
[C@H]1([C@H]([C@H]([C@@H](O[C@H]1C)O[C@@H]1[C@H]([C@@H](O[C@@H]([C@H]1OC(=O)/C=C/c1cc(c(cc1)O)OC)CO)OCCc1ccc(c(c1)O)OC)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Labiatae | Leucosceptrum japonicum | Ref. |
| Plantae | Labiatae | Prostanthera melissifolia | Ref. |
| Plantae | Labiatae | Schnabelia tetradonta | Ref. |
| Plantae | Labiatae | Scutellaria albida subsp.albida | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Malvaceae | Firmiana platanifolia | Ref. |
| Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
| Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
| Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Plantaginaceae | Bacopa monniera | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Veronica anagallis-aquatica | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
| Plantae | Scrophulariaceae | Verbascum wiedemannianum | Ref. |
| - | - | Pentemon gentianoides HBK | Ref. |
|
|
zoom in
| Organism | Rehmannia glutinosa |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Sahin, et al., Phytochemistry, 65, (2004), 2095.
Hou, et al., Journal of Natural Products, 65, (2002), 1759.
Dou, et al., Journal of Natural Products, 65, (2002), 1777.
Budzianowska, et al., Planta Med, 70, (2004), 834.
Abougazar, et al., Planta Med, 69, (2003), 814 |
|---|
|
