| Name |
Corilagin |
| Formula |
C27H22O18 |
| Mw |
634.0806139 |
| CAS RN |
23094-69-1 |
| C_ID |
C00002915
, 
|
| InChIKey |
TUSDEZXZIZRFGC-XMMARQRUNA-N |
| InChICode |
InChI=1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)23-19(35)13(43-27)5-42-25(40)7-3-11(30)17(33)20(36)14(7)15-8(26(41)44-23)4-12(31)18(34)21(15)37/h1-4,13,19,22-23,27-38H,5H2/t13-,19+,22-,23+,27+/m1/s1 |
| SMILES |
c1(cc2c(c(c1O)O)c1c(cc(c(c1O)O)O)C(=O)OC[C@H]1O[C@H]([C@@H]([C@H]([C@H]1O)OC2=O)O)OC(=O)c1cc(c(c(c1)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Poupartia fordii | Ref. |
| Plantae | Anacardiaceae | Rhus semialata  | Ref. |
| Plantae | Combretaceae | Anogeissus latifolia | Ref. |
| Plantae | Combretaceae | Terminalia chebula | Ref. |
| Plantae | Cunoniaceae | Cunonia macrophylla | Ref. |
| Plantae | Euphorbiaceae | Aleurites cordata | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis | Ref. |
| Plantae | Euphorbiaceae | Sapium japonicum | Ref. |
| Plantae | Euphorbiaceae | Sapium sebiferum | Ref. |
| Plantae | Geraniaceae | Geranium thunbergii | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
| Plantae | Nymphaeaceae | Nymphaea stellata | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus urinaria | Ref. |
| Plantae | Sapindaceae | Acer nikoense | Ref. |
| Plantae | Sapindaceae | Acer spp. | Ref. |
| - | - | Euphoria longana | Ref. |
|
|
zoom in
| Organism | Acer nikoense |
|---|
| Reference | Shen, et al., Planta Med, 69, (2003), 1109.
Fogliani, et al., Phytochemistry, 66, (2005), 241.
Calixto, et al., Planta Med, 70, (2004), 93.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|
