Name |
Norswertianin 1,3,7,8-Tetrahydroxanthone |
Formula |
C13H8O6 |
Mw |
260.03208799 |
CAS RN |
22172-15-2 |
C_ID |
C00002970
,
|
InChIKey |
RVOUOPDWADMVBA-UHFFFAOYSA-N |
InChICode |
InChI=1S/C13H8O6/c14-5-3-7(16)10-9(4-5)19-8-2-1-6(15)12(17)11(8)13(10)18/h1-4,14-17H |
SMILES |
c1c(c(c2c(c1)oc1c(c2=O)c(cc(c1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Gentianaceae | Canscora decussata | Ref. |
Plantae | Gentianaceae | Chironia krebsii | Ref. |
Plantae | Gentianaceae | Gentiana bavarica | Ref. |
Plantae | Gentianaceae | Orphium frutescens | Ref. |
Plantae | Gentianaceae | Swertia chirata | Ref. |
Plantae | Gentianaceae | Swertia dilatata | Ref. |
Plantae | Gentianaceae | Swertia erythrosticta | Ref. |
Plantae | Gentianaceae | Swertia gracilescens | Ref. |
Plantae | Gentianaceae | Swertia hookeri | Ref. |
Plantae | Gentianaceae | Swertia iberica | Ref. |
Plantae | Gentianaceae | Swertia japonica | Ref. |
Plantae | Gentianaceae | Swertia lawii | Ref. |
Plantae | Gentianaceae | Swertia nervosa | Ref. |
Plantae | Gentianaceae | Swertia perennis | Ref. |
Plantae | Gentianaceae | Swertia purpurascens | Ref. |
Plantae | Gentianaceae | Swertia racemosa | Ref. |
Plantae | Gentianaceae | Swertia swertiopsis | Ref. |
Plantae | Gentianaceae | Swertia swertopsis | Ref. |
|
|
zoom in
Organism | Swertia swertiopsis | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
---|
|