Name |
Longifolene aldehyde Longifolene |
Formula |
C15H24 |
Mw |
204.18780077 |
CAS RN |
475-20-7 |
C_ID |
C00003162
,
|
InChIKey |
PDSNLYSELAIEBU-UHFFFAOYNA-N |
InChICode |
InChI=1S/C15H24/c1-10-11-6-7-12-13(11)14(2,3)8-5-9-15(10,12)4/h11-13H,1,5-9H2,2-4H3/t11-,12-,13+,15+/m0/s1 |
SMILES |
[C@H]12CC[C@@H]3[C@@](C1=C)(CCCC([C@H]23)(C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Pleosporaceae | Cochliobolus sativus | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Cupressaceae | Juniperus communis L. | Ref. |
Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
Plantae | Herbertaceae | Herbertus sakuraii | Ref. |
Plantae | Jubulaceae | Frullania congesta | Ref. |
Plantae | Labiatae | Ocimum americanum | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L. | Ref. |
Plantae | Pinaceae | Cedrus libani | Ref. |
Plantae | Pinaceae | Pinus eldarica | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus kochiana | Ref. |
Plantae | Pinaceae | Pinus longifolia | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus pallasiana | Ref. |
Plantae | Pinaceae | Pinus palustris | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pinus sosnowskyi | Ref. |
Plantae | Pinaceae | Pinus sylvestris L.var.sylvestris. | Ref. |
Plantae | Pinaceae | Pinus thunbergi | Ref. |
Plantae | Ranunculaceae | Nigella sativa L | Ref. |
Plantae | Schisandraceae | Schisandra chinensis | Ref. |
Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
Plantae | Verbenaceae | Lippia chevalieri | Ref. |
|
|
zoom in
Organism | Pinus palustris | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
---|
|