Name |
Artemetin Quercetagetin 3,6,7,3',4'-pentamethyl ether 3,6,7,3',4'-Pentamethylquercetagetin 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
Formula |
C20H20O8 |
Mw |
388.11581762 |
CAS RN |
479-90-3 |
C_ID |
C00004712
, 
|
InChIKey |
RIGYMJVFEJNCKD-UHFFFAOYSA-N |
InChICode |
InChI=1S/C20H20O8/c1-23-11-7-6-10(8-12(11)24-2)18-20(27-5)17(22)15-13(28-18)9-14(25-3)19(26-4)16(15)21/h6-9,21H,1-5H3 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)OC)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea clavennae | Ref. |
Plantae | Asteraceae | Achillea conferta | Ref. |
Plantae | Asteraceae | Achillea millefolium L.  | Ref. |
Plantae | Asteraceae | Achillea sibirica subsp.mongolica | Ref. |
Plantae | Asteraceae | Artemisia absinthium  | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Artemisia mongolica | Ref. |
Plantae | Asteraceae | Artemisia verlotiorum | Ref. |
Plantae | Asteraceae | Blumea eriantha  | Ref. |
Plantae | Asteraceae | Blumea malcomii | Ref. |
Plantae | Asteraceae | Brickellia spp. | Ref. |
Plantae | Asteraceae | Inula britannica  | Ref. |
Plantae | Asteraceae | Parthenium incanum | Ref. |
Plantae | Asteraceae | Parthenium rollinsianum | Ref. |
Plantae | Boraginaceae | Cordia verbenacea  | Ref. |
Plantae | Bromeliaceae | Tillandsia purpurea | Ref. |
Plantae | Buxaceae | Buxus sempervirens  | Ref. |
Plantae | Labiatae | Callicarpa pilosissima | Ref. |
Plantae | Labiatae | Vitex rotundifolia  | Ref. |
Plantae | Moraceae | Ficus altissima  | Ref. |
Plantae | Plantaginaceae | Adenosma capitatum | Ref. |
Plantae | Verbenaceae | Verbena officinalis  | Ref. |
|
|
zoom in
Organism | Buxus sempervirens | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Mazur,Bull.Res.Council Israel A.,5,(1955),67
Herz,J.Org.Chem.,26,(1961),3014 |
---|
|