| Name |
Isorhamnetin 3-galactoside
Isorhamnetin 3-O-galactoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
6743-92-6 |
| C_ID |
C00005524
, 
|
| InChIKey |
CQLRUIIRRZYHHS-HTTJNPAHNA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)25)20-21(17(28)15-11(26)5-9(24)6-13(15)32-20)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16+,18-,19-,22+/m1/s1 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)OC)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Amsonia ciliata | Ref. |
| Plantae | Asteraceae | Brickellia chlorolepis | Ref. |
| Plantae | Asteraceae | Gutierrezia grandis | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata L. | Ref. |
| Plantae | Convallariaceae | Convallaria majalis L.  | Ref. |
| Plantae | Cruciferae | Sinapis flexuosa | Ref. |
| Plantae | Fabaceae | Anthyllis onobrychioides | Ref. |
| Plantae | Fabaceae | Anthyllis subsimplex | Ref. |
| Plantae | Fabaceae | Anthyllis vulneraria | Ref. |
| Plantae | Fabaceae | Macroptilium erythroloma | Ref. |
| Plantae | Fabaceae | Onobrychis angustifolia | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
| Plantae | Fabaceae | Vigna spp. | Ref. |
| Plantae | Iridaceae | Patersonia sericea | Ref. |
| Plantae | Myrsinaceae | Lysimachia vulgaris var. davurica | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Rosaceae | Pyrus bourgaeana | Ref. |
| Plantae | Rutaceae | Haplophyllum pedicellatum | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
| Plantae | Taxodiaceae | Taxodium distichum | Ref. |
| Plantae | Velloziaceae | Barbacenia rubro-virens | Ref. |
| - | - | Aceraceae negundo | Ref. |
| - | - | Cereus grandiflorus | Ref. |
|
|
zoom in
| Organism | Abies amabilis |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Horhammer,Chem.Ber.,99,(1966),1384 |
|---|
|
