Name |
Formononetin 7-Hydroxy-4'-methoxyisoflavone |
Formula |
C16H12O4 |
Mw |
268.07355887 |
CAS RN |
485-72-3 |
C_ID |
C00002525
,
|
InChIKey |
HKQYGTCOTHHOMP-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-9,17H,1H3 |
SMILES |
c1(ccc2c(c1)occ(c2=O)c1ccc(cc1)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
Plantae | Euphorbiaceae | Euphorbia portlandica | Ref. |
Plantae | Fabaceae | Albizia procera | Ref. |
Plantae | Fabaceae | Amorpha fruticosa | Ref. |
Plantae | Fabaceae | Andira inermis | Ref. |
Plantae | Fabaceae | Astragalus clusii | Ref. |
Plantae | Fabaceae | Astragalus membranaceus | Ref. |
Plantae | Fabaceae | Astragalus mongholicus | Ref. |
Plantae | Fabaceae | Astragalus propinquus | Ref. |
Plantae | Fabaceae | Baptisia alba | Ref. |
Plantae | Fabaceae | Baptisia arachnifera | Ref. |
Plantae | Fabaceae | Baptisia australis | Ref. |
Plantae | Fabaceae | Baptisia bracteata | Ref. |
Plantae | Fabaceae | Baptisia calycosa | Ref. |
Plantae | Fabaceae | Baptisia cinerea | Ref. |
Plantae | Fabaceae | Baptisia lanceolata | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Baptisia megacarpa | Ref. |
Plantae | Fabaceae | Baptisia nuttalliana | Ref. |
Plantae | Fabaceae | Baptisia perfoliata | Ref. |
Plantae | Fabaceae | Baptisia simplicifolia | Ref. |
Plantae | Fabaceae | Baptisia sphaerocarpa | Ref. |
Plantae | Fabaceae | Baptisia tinctoria | Ref. |
Plantae | Fabaceae | Caragana intermedia | Ref. |
Plantae | Fabaceae | Caragana jubata | Ref. |
Plantae | Fabaceae | Caragana microphylla | Ref. |
Plantae | Fabaceae | Castanospermum australe | Ref. |
Plantae | Fabaceae | Centrolobium robustum | Ref. |
Plantae | Fabaceae | Centrolobium sclerophyllum | Ref. |
Plantae | Fabaceae | Centrolobium tomentosum | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Centrosema virginianum | Ref. |
Plantae | Fabaceae | Cicer anatolicum | Ref. |
Plantae | Fabaceae | Cicer arietinum | Ref. |
Plantae | Fabaceae | Cicer bijugum | Ref. |
Plantae | Fabaceae | Cicer canariensis | Ref. |
Plantae | Fabaceae | Cicer chorassanicum | Ref. |
Plantae | Fabaceae | Cicer cuneatum | Ref. |
Plantae | Fabaceae | Cicer echinospermum | Ref. |
Plantae | Fabaceae | Cicer judaicum | Ref. |
Plantae | Fabaceae | Cicer judicum | Ref. |
Plantae | Fabaceae | Cicer macracanthum | Ref. |
Plantae | Fabaceae | Cicer microphyllum | Ref. |
Plantae | Fabaceae | Cicer mogolatvicum | Ref. |
Plantae | Fabaceae | Cicer montbretii | Ref. |
Plantae | Fabaceae | Cicer nuristanicum | Ref. |
Plantae | Fabaceae | Cicer oxyodon | Ref. |
Plantae | Fabaceae | Cicer pinnatifidum | Ref. |
Plantae | Fabaceae | Cicer pungens | Ref. |
Plantae | Fabaceae | Cicer rechingeri | Ref. |
Plantae | Fabaceae | Cicer reticulatum | Ref. |
Plantae | Fabaceae | Cicer songaricum | Ref. |
Plantae | Fabaceae | Cicer yamashitae | Ref. |
Plantae | Fabaceae | Cladrastis kentukea | Ref. |
Plantae | Fabaceae | Cladrastis sikokiana | Ref. |
Plantae | Fabaceae | Cytisus proliferus | Ref. |
Plantae | Fabaceae | Dalbergia baronii | Ref. |
Plantae | Fabaceae | Dalbergia barretoana | Ref. |
Plantae | Fabaceae | Dalbergia candenatensis | Ref. |
Plantae | Fabaceae | Dalbergia cearensis | Ref. |
Plantae | Fabaceae | Dalbergia ecastophyllum | Ref. |
Plantae | Fabaceae | Dalbergia frutescens | Ref. |
Plantae | Fabaceae | Dalbergia inundata | Ref. |
Plantae | Fabaceae | Dalbergia lanceolaria | Ref. |
Plantae | Fabaceae | Dalbergia monetaria | Ref. |
Plantae | Fabaceae | Dalbergia nitidula | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dalbergia parviflora | Ref. |
Plantae | Fabaceae | Dalbergia spruceana | Ref. |
Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
Plantae | Fabaceae | Dalbergia volubilis | Ref. |
Plantae | Fabaceae | Derris oblonga | Ref. |
Plantae | Fabaceae | Diplotropis purpurea | Ref. |
Plantae | Fabaceae | Echinospartum horridum | Ref. |
Plantae | Fabaceae | Genista aetnensis | Ref. |
Plantae | Fabaceae | Genista canariensis | Ref. |
Plantae | Fabaceae | Genista nissana | Ref. |
Plantae | Fabaceae | Genista pulchella | Ref. |
Plantae | Fabaceae | Genista salzmannii | Ref. |
Plantae | Fabaceae | Genista sessilifolia | Ref. |
Plantae | Fabaceae | Genista subcapitata | Ref. |
Plantae | Fabaceae | Genista teretifolia | Ref. |
Plantae | Fabaceae | Genista tinctoria | Ref. |
Plantae | Fabaceae | Gliricidia sepium | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza echinata | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza glara | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza palidiflora | Ref. |
Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Hedysarum multijugum | Ref. |
Plantae | Fabaceae | Hedysarum polybotrys | Ref. |
Plantae | Fabaceae | Maackia amurensis | Ref. |
Plantae | Fabaceae | Maackia fauriei | Ref. |
Plantae | Fabaceae | Machaerium kuhlmannii | Ref. |
Plantae | Fabaceae | Machaerium nyctitans | Ref. |
Plantae | Fabaceae | Machaerium vestitum | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago intertexta | Ref. |
Plantae | Fabaceae | Medicago monspeliaca | Ref. |
Plantae | Fabaceae | Medicago radiata | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Melilotus italica | Ref. |
Plantae | Fabaceae | Melilotus messanensis | Ref. |
Plantae | Fabaceae | Millettia dielsiana | Ref. |
Plantae | Fabaceae | Millettia dura | Ref. |
Plantae | Fabaceae | Millettia pendula | Ref. |
Plantae | Fabaceae | Myroxylon balsamum | Ref. |
Plantae | Fabaceae | Onobrychis viciifolia | Ref. |
Plantae | Fabaceae | Ononis speciosa | Ref. |
Plantae | Fabaceae | Ononis spinosa | Ref. |
Plantae | Fabaceae | Otholobium bracteolatum | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Otholobium uncinatum | Ref. |
Plantae | Fabaceae | Pericopsis laxiflora | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pickeringia montana | Ref. |
Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Psoralea fascicularis | Ref. |
Plantae | Fabaceae | Pterocarpus indicus | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium | Ref. |
Plantae | Fabaceae | Pterocarpus soyauxii | Ref. |
Plantae | Fabaceae | Pueraria lobata | Ref. |
Plantae | Fabaceae | Pueraria tuberosa | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Sophora secundiflora | Ref. |
Plantae | Fabaceae | Sophora tomentosa | Ref. |
Plantae | Fabaceae | Spartium junceum | Ref. |
Plantae | Fabaceae | Spatholobus suberectus | Ref. |
Plantae | Fabaceae | Swartzia polyphylla | Ref. |
Plantae | Fabaceae | Taverniera abyssinica | Ref. |
Plantae | Fabaceae | Thermopsis alterniflora | Ref. |
Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
Plantae | Fabaceae | Thermopsis mollis | Ref. |
Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
Plantae | Fabaceae | Thermopsis villosa | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fabaceae | Trifolium alpestre | Ref. |
Plantae | Fabaceae | Trifolium medium | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium pratense, | Ref. |
Plantae | Fabaceae | Trifolium subterraneum | Ref. |
Plantae | Fabaceae | Trifolium willdenovii | Ref. |
Plantae | Fabaceae | Trigonella anguina | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Trigonella laciniata | Ref. |
Plantae | Fabaceae | Trigonella maritima | Ref. |
Plantae | Fabaceae | Trigonella spicata | Ref. |
Plantae | Fabaceae | Ulex micranthus | Ref. |
Plantae | Fabaceae | Vatairea heteroptera | Ref. |
Plantae | Fabaceae | Vigna radiata | Ref. |
Plantae | Fabaceae | Virgilia oroboides | Ref. |
Plantae | Fabaceae | Wisteria brachybotrys | Ref. |
Plantae | Fabaceae | Zollernia paraensis | Ref. |
Plantae | Myristicaceae | Virola caducifolia | Ref. |
Plantae | Myristicaceae | Virola multinervia | Ref. |
Plantae | Myristicaceae | Virola surinamensis | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Papaveraceae | Eschscholzia californica | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
- | - | Sarcolobus globosus | Ref. |
|
|
zoom in
Organism | Virola multinervia | Reference | Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Shi, et al., Chinese J of Pharm Analysis, 30, (2010), 114.
Kraft, et al., Phytochemistry, 58, (2001), 769.
Madureira, et al., Planta Med, 70, (2004), 828.
Matsuda, et al., Planta Med, 70, (2004), 1201.
Erasto, et al., Phytochemistry, 65, (2004), 875.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Cai, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 27, (1992), 748.
Gu, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 32, (1997), 59.
Zhang, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 32, (1997), 301. |
---|
|