Name |
Nerol cis-Geraniol (Z)-Geraniol |
Formula |
C10H18O |
Mw |
154.1357652 |
CAS RN |
106-25-2 |
C_ID |
C00000855
, 
|
InChIKey |
GLZPCOQZEFWAFX-YFHOEESVSA-N |
InChICode |
InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7- |
SMILES |
C(CC=C(C)C)/C(=C\CO)/C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Cananga odorata  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Fabaceae | Trifolium repens  | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
Plantae | Labiatae | Dracocephalum moldavicum  | Ref. |
Plantae | Labiatae | Melissa officinalis  | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Oleaceae | Osmanthus fragrans  | Ref. |
Plantae | Piperaceae | Piper arboreum  | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Poaceae | Cymbopogon citratus  | Ref. |
Plantae | Rosaceae | Rosa rugosa  | Ref. |
Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
Plantae | Rutaceae | Citrus aurantium var.amara  | Ref. |
Plantae | Rutaceae | Citrus grandis  | Ref. |
Plantae | Rutaceae | Citrus junos  | Ref. |
Plantae | Rutaceae | Citrus laurifolius | Ref. |
Plantae | Rutaceae | Citrus limettioides | Ref. |
Plantae | Rutaceae | Citrus paradisi  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
Plantae | Solanaceae | Nicotiana tobacum | Ref. |
Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
- | - | Baeckea frutescens L.  | Ref. |
- | - | Eriobtrya japonica | Ref. |
|
|
zoom in
Organism | Rosa rugosa | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
---|
|