Name |
Ampelopsin Dihydromyricetin (2R,3R)-3,5,7,3',4',5'-Hexahydroxyflavanone (+)-Ampelopsin |
Formula |
C15H12O8 |
Mw |
320.05321736 |
CAS RN |
27200-12-0 |
C_ID |
C00000938
, 
|
InChIKey |
KJXSIXMJHKAJOD-PVRQQBJHNA-N |
InChICode |
InChI=1S/C15H12O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,14-20,22H/t14-,15+/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H]([C@H](C2=O)O)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
Plantae | Berberidaceae | Mahonia siamensis | Ref. |
Plantae | Cercidiphyllaceae | Cercidiphyllum japonicum | Ref. |
Plantae | Cruciferae | Brassica carinata Y line  | Ref. |
Plantae | Ericaceae | Rhododendron cinnabarinum  | Ref. |
Plantae | Ericaceae | Rhododendron spp. | Ref. |
Plantae | Fabaceae | Adenanthera pavonina  | Ref. |
Plantae | Fabaceae | Intsia bijuga  | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca  | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Lythraceae | Punica granatum L.  | Ref. |
Plantae | Meliaceae | Soymida febrifuga  | Ref. |
Plantae | Myrtaceae | Pimenta dioica  | Ref. |
Plantae | Myrtaceae | Syzygium cumini  | Ref. |
Plantae | Pinaceae | Cedrus deodara  | Ref. |
Plantae | Pinaceae | Picea abies  | Ref. |
Plantae | Pinaceae | Pinus spp.  | Ref. |
Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
Plantae | Poaceae | Zea mays  | Ref. |
Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
Plantae | Rutaceae | Citrus incanus | Ref. |
Plantae | Sapindaceae | Xanthoceras sorbifolia  | Ref. |
Plantae | Sapotaceae | Manilkara zapota cv.Tikal  | Ref. |
Plantae | Saxifragaceae | Heuchera villosa | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Solanaceae | Capsicum annuum  | Ref. |
Plantae | Solanaceae | Petunia hybrida | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Vitaceae | Ampelopsis meliaefolia | Ref. |
Plantae | Vitaceae | Vitis rotundifolia  | Ref. |
- | - | Nympaea spp. | Ref. |
|
|
zoom in
Organism | Pinus spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 711,Flavanones and dihydroflavonols
Kotake,Liebigs Ann.Chem.,544,(1940),253
Harborne,Phytochem.,10,(1971),2727 |
---|
|