| Name |
Naringin |
| Formula |
C27H32O14 |
| Mw |
580.17920573 |
| CAS RN |
10236-47-2 |
| C_ID |
C00000983
, 
|
| InChIKey |
DFPMSGMNTNDNHN-RVVDGNGFNA-N |
| InChICode |
InChI=1S/C27H32O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-7,10,16,18,20-30,32-36H,8-9H2,1H3/t10-,16-,18-,20-,21+,22-,23-,24+,25+,26-,27+/m0/s1 |
| SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1ccc(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Evodiopanax spp. | Ref. |
| Plantae | Aspleniaceae | Ceterach officinarum  | Ref. |
| Plantae | Aspleniaceae | Ceterach sp. | Ref. |
| Plantae | Asteraceae | Centaurea spp. | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Fabaceae | Flemingia strobilifera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
| Plantae | Labiatae | Origanum vulgare | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Polypodiaceae | Drynaria fortunei | Ref. |
| Plantae | Pteridaceae | Adiantum spp. | Ref. |
| Plantae | Rutaceae | Citrus aurantium | Ref. |
| Plantae | Rutaceae | Citrus decumana | Ref. |
| Plantae | Rutaceae | Citrus grandis | Ref. |
| Plantae | Rutaceae | Citrus grandis var.tomentosa | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Rutaceae | Citrus natsudaidai | Ref. |
| Plantae | Rutaceae | Citrus paradisi | Ref. |
| Plantae | Rutaceae | Citrus reticulata | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus sudachi | Ref. |
| Plantae | Rutaceae | Citrus unshiu | Ref. |
| Plantae | Rutaceae | Fortunella sp. | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
| Plantae | Solanaceae | Solanum tuberosum | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Clymenia polyandra | Ref. |
| - | - | Leptoshaeria maculans | Ref. |
|
|
zoom in
| Organism | Citrus grandis var.tomentosa |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Park, et al., Planta Med, 71, (2005), 24.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
