Name |
Cyanin Cyanidin 3,5-diglucoside |
Formula |
C27H31O16 |
Mw |
611.16120995 |
CAS RN |
2611-67-8 |
C_ID |
C00002378
,
|
InChIKey |
RDFLLVCQYHQOBU-ARDLSURDNA-O |
InChICode |
InChI=1S/C27H30O16/c28-7-17-19(33)21(35)23(37)26(42-17)40-15-5-10(30)4-14-11(15)6-16(25(39-14)9-1-2-12(31)13(32)3-9)41-27-24(38)22(36)20(34)18(8-29)43-27/h1-6,17-24,26-29,33-38H,7-8H2,(H2-,30,31,32)/p+1/t17-,18-,19+,20+,21-,22+,23+,24+,26+,27+/m0/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@@H]([C@@H]([C@@H](O1)CO)O)O)O)c1cc(c(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Aceraceae | Dipteronia sinensis | Ref. |
Plantae | Adoxaceae | Sambucus canadensis | Ref. |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Boraginaceae | Lobostemon spp. | Ref. |
Plantae | Bromeliaceae | Ananas comosus | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera caerulea | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Ericaceae | Rhododendron spp. | Ref. |
Plantae | Ericaceae | Vaccinium spp. | Ref. |
Plantae | Euphorbiaceae | Euphorbia tirucalli | Ref. |
Plantae | Fabaceae | Acacia leucophloea | Ref. |
Plantae | Fabaceae | Caesalpinia pulcherrima | Ref. |
Plantae | Fabaceae | Clitoria ternatea | Ref. |
Plantae | Fabaceae | Desmodium aparines | Ref. |
Plantae | Fabaceae | Erythrina spp. | Ref. |
Plantae | Fabaceae | Lathyrus sativus | Ref. |
Plantae | Fabaceae | Millettia zechiana | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Saraca indica | Ref. |
Plantae | Fumariaceae | Dicentra sp. | Ref. |
Plantae | Geraniaceae | Geranium sylvaticum | Ref. |
Plantae | Geraniaceae | Pelargonium dolomiticum | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Lythraceae | Punica granatum L. | Ref. |
Plantae | Malvaceae | Hibiscus spp. | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Myrsinaceae | Cyclamen persicum | Ref. |
Plantae | Myrtaceae | Metrosideros spp. | Ref. |
Plantae | Onagraceae | Fuchsia sp. | Ref. |
Plantae | Plantaginaceae | Penstemon spp. | Ref. |
Plantae | Polygonaceae | Rheum spp. | Ref. |
Plantae | Rosaceae | Fragaria spp. | Ref. |
Plantae | Rosaceae | Malus spp. | Ref. |
Plantae | Rosaceae | Prunus spp. | Ref. |
Plantae | Rosaceae | Rosa spp. | Ref. |
Plantae | Saxifragaceae | Saxifraga sp. | Ref. |
Plantae | Theaceae | Camellia sp. | Ref. |
Plantae | Vitaceae | Vitis spp. | Ref. |
|
|
zoom in
Organism | Millettia zechiana | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann,401(1913),189 |
---|
|